Index of /CriminalandCivilIndex/Box 02 B
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | Arabello,A. - Marbon..> | 2015-03-18 12:06 | 780K | |
![[ ]](/icons/layout.gif) | Automobile,Hudson,Se..> | 2015-03-18 12:08 | 1.3M | |
![[ ]](/icons/layout.gif) | Automobile,Maxwell T..> | 2015-03-18 12:09 | 806K | |
![[ ]](/icons/layout.gif) | Automobile - Automob..> | 2015-03-18 12:06 | 1.1M | |
![[ ]](/icons/layout.gif) | Automobile - Mack,L.pdf | 2015-03-18 12:07 | 812K | |
![[ ]](/icons/layout.gif) | Board of Trustees Lo..> | 2015-03-18 12:09 | 836K | |
![[ ]](/icons/layout.gif) | Goldtech Industries,..> | 2015-03-18 12:10 | 2.3M | |
![[ ]](/icons/layout.gif) | Goll,F. - Gomez,G.pdf | 2015-03-18 12:11 | 1.7M | |
![[ ]](/icons/layout.gif) | Gong, To - Gonzalez,..> | 2015-03-18 12:12 | 1.1M | |
![[ ]](/icons/layout.gif) | Gonzalez,G. - Golkin..> | 2015-03-18 12:12 | 1.0M | |
![[ ]](/icons/layout.gif) | Goodman,C. - Goodman..> | 2015-03-18 12:14 | 1.3M | |
![[ ]](/icons/layout.gif) | Goodman Refrigerated..> | 2015-03-18 12:13 | 1.2M | |
![[ ]](/icons/layout.gif) | Goodwin,E. - Goodyea..> | 2015-03-18 12:15 | 1.2M | |
![[ ]](/icons/layout.gif) | Goodyear Tire & Rubb..> | 2015-03-18 12:15 | 2.1M | |
![[ ]](/icons/layout.gif) | Gordon,A. - Gordon,G..> | 2015-03-18 12:17 | 1.1M | |
![[ ]](/icons/layout.gif) | Gordon,G. - Gordon,P..> | 2015-03-18 12:17 | 1.1M | |
![[ ]](/icons/layout.gif) | Gordon, P. - Goret,T..> | 2015-03-18 12:16 | 1.3M | |
![[ ]](/icons/layout.gif) | Gorewitz,M. - Gorman..> | 2015-03-18 12:18 | 1.0M | |
![[ ]](/icons/layout.gif) | Gorman,W. dec'd. - G..> | 2015-03-18 12:19 | 1.1M | |
![[ ]](/icons/layout.gif) | Gotfried,A. - Gottli..> | 2015-03-18 12:19 | 816K | |
![[ ]](/icons/layout.gif) | Gottlieb,I. - Gould,..> | 2015-03-18 12:20 | 772K | |
![[ ]](/icons/layout.gif) | Gould,C. - Graf,J.pdf | 2015-03-18 12:20 | 883K | |
![[ ]](/icons/layout.gif) | Goulher, Det. - Gowa..> | 2015-03-18 12:22 | 1.5M | |
![[ ]](/icons/layout.gif) | Gowdy,A. - Grabowski..> | 2015-03-18 12:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Graboski,J. - Gracel..> | 2015-03-18 12:23 | 831K | |
![[ ]](/icons/layout.gif) | Gracer Co.,Inc., D. ..> | 2015-03-18 12:24 | 948K | |
![[ ]](/icons/layout.gif) | Graf,J. - Graham Co.pdf | 2015-03-18 12:25 | 1.1M | |
![[ ]](/icons/layout.gif) | Graham,W. - Granberr..> | 2015-03-18 12:26 | 791K | |
![[ ]](/icons/layout.gif) | Graham Corp. - Graha..> | 2015-03-18 12:25 | 897K | |
![[ ]](/icons/layout.gif) | Grancarlo,V. - Grand..> | 2015-03-18 12:27 | 2.1M | |
![[ ]](/icons/layout.gif) | Grand Jury Impaneled..> | 2015-03-18 12:27 | 692K | |
![[ ]](/icons/layout.gif) | Grand View Structura..> | 2015-03-18 12:28 | 942K | |
![[ ]](/icons/layout.gif) | Grant, A. & Co. - Gr..> | 2015-03-18 12:29 | 932K | |
![[ ]](/icons/layout.gif) | Grant,N. - Grapa,O. ..> | 2015-03-18 12:29 | 868K | |
![[ ]](/icons/layout.gif) | Grape Drink, - Grass..> | 2015-03-18 12:30 | 927K | |
![[ ]](/icons/layout.gif) | Grasso Produce Co.,J..> | 2015-03-18 12:31 | 1.1M | |
![[ ]](/icons/layout.gif) | Gravely,J.,Jr. - Gra..> | 2015-03-18 12:32 | 1.1M | |
![[ ]](/icons/layout.gif) | Gray,C. - Gray,J.pdf | 2015-03-18 12:32 | 2.0M | |
![[ ]](/icons/layout.gif) | Gray,J. - Gray,W.,Jr..> | 2015-03-18 12:33 | 1.7M | |
![[ ]](/icons/layout.gif) | Gray,W. - Grazul,B.pdf | 2015-03-18 12:34 | 1.2M | |
![[ ]](/icons/layout.gif) | Grazul (or Grazula),..> | 2015-03-18 12:35 | 2.0M | |
![[ ]](/icons/layout.gif) | Great Atlantic & Pac..> | 2015-03-18 12:36 | 2.0M | |
![[ ]](/icons/layout.gif) | Great Northen Leasin..> | 2015-03-18 12:37 | 2.6M | |
![[ ]](/icons/layout.gif) | Greater City Surety ..> | 2015-03-18 12:38 | 3.0M | |
![[ ]](/icons/layout.gif) | Greater Trenton Coun..> | 2015-03-18 12:39 | 2.5M | |
![[ ]](/icons/layout.gif) | Greeley,J. - Green,C..> | 2015-03-18 12:39 | 1.2M | |
![[ ]](/icons/layout.gif) | Green,C. - Green,H.pdf | 2015-03-18 12:41 | 1.3M | |
![[ ]](/icons/layout.gif) | Green,H. - Green,L.pdf | 2015-03-18 12:41 | 1.1M | |
![[ ]](/icons/layout.gif) | Green,J. - Greenberg..> | 2015-03-18 12:42 | 1.1M | |
![[ ]](/icons/layout.gif) | Green,L. Prin. - Gre..> | 2015-03-18 12:43 | 1.2M | |
![[ ]](/icons/layout.gif) | Green,S. - Greenbaum..> | 2015-03-18 12:44 | 1.5M | |
![[ ]](/icons/layout.gif) | Green Products,Inc. ..> | 2015-03-18 12:40 | 796K | |
![[ ]](/icons/layout.gif) | Greenbaum,L. - Green..> | 2015-03-18 12:44 | 1.1M | |
![[ ]](/icons/layout.gif) | Greenblat,B. - Green..> | 2015-03-18 12:45 | 948K | |
![[ ]](/icons/layout.gif) | Greenlee,B. - Greenw..> | 2015-03-18 12:46 | 802K | |
![[ ]](/icons/layout.gif) | Greenwald,A. - Greer..> | 2015-03-18 12:46 | 774K | |
![[ ]](/icons/layout.gif) | Greer,T. (Major Gen...> | 2015-03-18 12:47 | 779K | |
![[ ]](/icons/layout.gif) | Gregory,C. - Greible..> | 2015-03-18 12:48 | 1.4M | |
![[ ]](/icons/layout.gif) | Greich,M. - Greyhoun..> | 2015-03-18 12:49 | 1.6M | |
![[ ]](/icons/layout.gif) | Greyhound Bus Lines,..> | 2015-03-18 12:49 | 790K | |
![[ ]](/icons/layout.gif) | Greystone Park State..> | 2015-03-18 12:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Griffen,D. - Griffen..> | 2015-03-18 12:51 | 836K | |
![[ ]](/icons/layout.gif) | Griffen,W. - Griger,..> | 2015-03-18 12:51 | 799K | |
![[ ]](/icons/layout.gif) | Griger's,J.,Sons,Inc..> | 2015-03-18 12:52 | 751K | |
![[ ]](/icons/layout.gif) | Grimaldi,F. - Grinne..> | 2015-03-18 12:53 | 820K | |
![[ ]](/icons/layout.gif) | Grinnell Corp. - Gro..> | 2015-03-18 12:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Grobart,M. - Groff,R..> | 2015-03-18 12:54 | 904K | |
![[ ]](/icons/layout.gif) | Groff & Skidmore,Inc..> | 2015-03-18 12:55 | 901K | |
![[ ]](/icons/layout.gif) | Groomes,R., Superint..> | 2015-03-18 12:56 | 1.1M | |
![[ ]](/icons/layout.gif) | Grossbardt,I. - Gros..> | 2015-03-18 12:56 | 698K | |
![[ ]](/icons/layout.gif) | Grossman,I. - Grosso..> | 2015-03-18 12:57 | 713K | |
![[ ]](/icons/layout.gif) | Grosso,L. - Grover,S..> | 2015-03-18 12:58 | 727K | |
![[ ]](/icons/layout.gif) | Grover,T. - Gruber,M..> | 2015-03-18 12:58 | 650K | |
![[ ]](/icons/layout.gif) | Gruber,R. - Gruno,M.pdf | 2015-03-18 12:59 | 737K | |
![[ ]](/icons/layout.gif) | Gruno,P. - Gsell Mov..> | 2015-03-18 13:00 | 750K | |
![[ ]](/icons/layout.gif) | Gsell Moving & Stora..> | 2015-03-18 13:00 | 874K | |
![[ ]](/icons/layout.gif) | Guardabacio,J. - Gua..> | 2015-03-18 13:01 | 713K | |
![[ ]](/icons/layout.gif) | Guark,S. - Guerlain,..> | 2015-03-18 13:02 | 722K | |
![[ ]](/icons/layout.gif) | GuerlainInc., - Guia..> | 2015-03-18 13:02 | 691K | |
![[ ]](/icons/layout.gif) | Guibilie,J. - Guilia..> | 2015-03-18 13:03 | 652K | |
![[ ]](/icons/layout.gif) | Guiliano,L. - Gulf I..> | 2015-03-18 13:03 | 796K | |
![[ ]](/icons/layout.gif) | Gulf Ins. Co. - Gull..> | 2015-03-18 13:04 | 749K | |
![[ ]](/icons/layout.gif) | Gullick,J. - Gunderm..> | 2015-03-18 13:05 | 767K | |
![[ ]](/icons/layout.gif) | Gunderman,L. - Gunth..> | 2015-03-18 13:05 | 713K | |
![[ ]](/icons/layout.gif) | Gunther,W. - Gurtman..> | 2015-03-18 13:06 | 764K | |
![[ ]](/icons/layout.gif) | Gurtman,I. - Guth,J.pdf | 2015-03-18 13:07 | 766K | |
![[ ]](/icons/layout.gif) | Gutheil,A. - Guttman..> | 2015-03-18 13:07 | 875K | |
![[ ]](/icons/layout.gif) | Guttmann,M. - Gwyn,L..> | 2015-03-18 13:08 | 742K | |
![[ ]](/icons/layout.gif) | Gwynn,R. - H. J. L.,..> | 2015-03-18 13:08 | 961K | |
![[ ]](/icons/layout.gif) | H. J. Trucking Co. -..> | 2015-03-18 13:09 | 726K | |
![[ ]](/icons/layout.gif) | HEW, Sect'y. of - He..> | 2015-03-18 14:26 | 1.0M | |
![[ ]](/icons/layout.gif) | HEW, Sect'y of - Sec..> | 2015-03-18 14:25 | 619K | |
![[ ]](/icons/layout.gif) | Haar,D. - Haberman,D..> | 2015-03-18 13:10 | 1.0M | |
![[ ]](/icons/layout.gif) | Haberman,H. - Hacket..> | 2015-03-18 13:10 | 825K | |
![[ ]](/icons/layout.gif) | Hackett,J. - Haddon,..> | 2015-03-18 13:11 | 837K | |
![[ ]](/icons/layout.gif) | Haddon Township Boar..> | 2015-03-18 13:12 | 1.0M | |
![[ ]](/icons/layout.gif) | Hafner's Diary - Hag..> | 2015-03-18 13:13 | 880K | |
![[ ]](/icons/layout.gif) | Hager,H. - Haggerty,..> | 2015-03-18 13:13 | 856K | |
![[ ]](/icons/layout.gif) | Haggerty,K.Jr. - Hai..> | 2015-03-18 13:14 | 940K | |
![[ ]](/icons/layout.gif) | Haig,J.,Jr. - Haines..> | 2015-03-18 13:15 | 807K | |
![[ ]](/icons/layout.gif) | Haines,J.,Sheriff - ..> | 2015-03-18 13:15 | 868K | |
![[ ]](/icons/layout.gif) | Halbedl,D. - Halibut..> | 2015-03-18 13:16 | 911K | |
![[ ]](/icons/layout.gif) | Halibut, - Hall,E.pdf | 2015-03-18 13:17 | 1.2M | |
![[ ]](/icons/layout.gif) | Hall,F. - Hall,L.pdf | 2015-03-18 13:17 | 1.1M | |
![[ ]](/icons/layout.gif) | Hall,L. - Hall,W.pdf | 2015-03-18 13:18 | 1.1M | |
![[ ]](/icons/layout.gif) | Hall,Z. - Halliwell ..> | 2015-03-18 13:19 | 1.2M | |
![[ ]](/icons/layout.gif) | Halliwell & Nielson ..> | 2015-03-18 13:19 | 1.0M | |
![[ ]](/icons/layout.gif) | Halpern Bros. - Hals..> | 2015-03-18 13:20 | 1.0M | |
![[ ]](/icons/layout.gif) | Halstead,W. - Hamble..> | 2015-03-18 13:21 | 1.0M | |
![[ ]](/icons/layout.gif) | Hamilton,R. - Hammac..> | 2015-03-18 13:22 | 1.0M | |
![[ ]](/icons/layout.gif) | Hamilton Constr. Co...> | 2015-03-18 13:21 | 809K | |
![[ ]](/icons/layout.gif) | Hamletonian Realty,I..> | 2015-03-18 13:23 | 961K | |
![[ ]](/icons/layout.gif) | Hammann,E. - Hanners..> | 2015-03-18 13:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Hammerstone,A. - Ham..> | 2015-03-18 13:24 | 814K | |
![[ ]](/icons/layout.gif) | Hamoy,S. - Hamrick,R..> | 2015-03-18 13:25 | 1.0M | |
![[ ]](/icons/layout.gif) | Hamrock,E.,Sr. - Han..> | 2015-03-18 13:26 | 1.0M | |
![[ ]](/icons/layout.gif) | Hancock,M. - Handel,..> | 2015-03-18 13:26 | 1.0M | |
![[ ]](/icons/layout.gif) | Handel,J. - Haneman,..> | 2015-03-18 13:27 | 1.1M | |
![[ ]](/icons/layout.gif) | Haneman,H. - Hankins..> | 2015-03-18 13:28 | 851K | |
![[ ]](/icons/layout.gif) | Hankinson,M. - Hanlo..> | 2015-03-18 13:29 | 1.2M | |
![[ ]](/icons/layout.gif) | Hanlon,J. - Hannah,W..> | 2015-03-18 13:29 | 741K | |
![[ ]](/icons/layout.gif) | Hannahan,J. - Hanove..> | 2015-03-18 13:30 | 767K | |
![[ ]](/icons/layout.gif) | Hanover Farms Co. - ..> | 2015-03-18 13:31 | 839K | |
![[ ]](/icons/layout.gif) | Hanselman,Inc.,C. - ..> | 2015-03-18 13:31 | 817K | |
![[ ]](/icons/layout.gif) | Hansen,W. - Hansusov..> | 2015-03-18 13:32 | 807K | |
![[ ]](/icons/layout.gif) | Hansvik,B. - Harbors..> | 2015-03-18 13:33 | 821K | |
![[ ]](/icons/layout.gif) | Harborside Terminal ..> | 2015-03-18 13:33 | 767K | |
![[ ]](/icons/layout.gif) | Hardin,J. - Hardt,H.pdf | 2015-03-18 13:34 | 879K | |
![[ ]](/icons/layout.gif) | Hardt,L. - Harfe,H.pdf | 2015-03-18 13:35 | 793K | |
![[ ]](/icons/layout.gif) | Haremelin,S. - Harms..> | 2015-03-18 13:35 | 798K | |
![[ ]](/icons/layout.gif) | Harff,F. - Harkins,G..> | 2015-03-18 13:36 | 1.0M | |
![[ ]](/icons/layout.gif) | Harkins,J. - Haremel..> | 2015-03-18 13:37 | 764K | |
![[ ]](/icons/layout.gif) | Harms, Inc. - Harold..> | 2015-03-18 13:37 | 874K | |
![[ ]](/icons/layout.gif) | Harold, The Deck Lig..> | 2015-03-18 13:38 | 743K | |
![[ ]](/icons/layout.gif) | Harper,W. - Harringt..> | 2015-03-18 13:38 | 775K | |
![[ ]](/icons/layout.gif) | Harrington,B. - Harr..> | 2015-03-18 13:39 | 794K | |
![[ ]](/icons/layout.gif) | Harris,C. - Harris,E..> | 2015-03-18 13:40 | 767K | |
![[ ]](/icons/layout.gif) | Harris,E. - Harris,J..> | 2015-03-18 13:40 | 811K | |
![[ ]](/icons/layout.gif) | Harris,J. - Harris,M..> | 2015-03-18 13:41 | 698K | |
![[ ]](/icons/layout.gif) | Harris,M. - Harris,P..> | 2015-03-18 13:41 | 725K | |
![[ ]](/icons/layout.gif) | Harris,P. - Harris,T..> | 2015-03-18 13:42 | 657K | |
![[ ]](/icons/layout.gif) | Harris,S. - Hart,C.pdf | 2015-03-18 13:43 | 741K | |
![[ ]](/icons/layout.gif) | Harris,T. - Harrison..> | 2015-03-18 13:43 | 763K | |
![[ ]](/icons/layout.gif) | Harrison,G. - Harris..> | 2015-03-18 13:44 | 768K | |
![[ ]](/icons/layout.gif) | Hart,C. - Hart,S.pdf | 2015-03-18 13:45 | 1.0M | |
![[ ]](/icons/layout.gif) | Hart,S. - Hayes,M.pdf | 2015-03-18 13:45 | 930K | |
![[ ]](/icons/layout.gif) | Hartford,G. - Hartma..> | 2015-03-18 13:47 | 837K | |
![[ ]](/icons/layout.gif) | Hartford Accid. & & ..> | 2015-03-18 13:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Hartman,H. - Hartsho..> | 2015-03-18 13:48 | 881K | |
![[ ]](/icons/layout.gif) | Hartshorne,C. - Harv..> | 2015-03-18 13:48 | 1.0M | |
![[ ]](/icons/layout.gif) | Harvey,A. - Harwood ..> | 2015-03-18 13:49 | 940K | |
![[ ]](/icons/layout.gif) | Harwood,L. - Hass,E.pdf | 2015-03-18 13:50 | 1.0M | |
![[ ]](/icons/layout.gif) | Hass,F.,Sr. - Hastin..> | 2015-03-18 13:50 | 882K | |
![[ ]](/icons/layout.gif) | Hastings,D. - Hathaw..> | 2015-03-18 13:51 | 948K | |
![[ ]](/icons/layout.gif) | Hatkazi,G. - Hatrak,..> | 2015-03-18 13:52 | 611K | |
![[ ]](/icons/layout.gif) | Hatrak,R. - Hatton,W..> | 2015-03-18 13:52 | 714K | |
![[ ]](/icons/layout.gif) | Hatton,W. - Haughey,..> | 2015-03-18 13:53 | 1.4M | |
![[ ]](/icons/layout.gif) | Haughn,J.,Jr. - Haut..> | 2015-03-18 13:54 | 1.2M | |
![[ ]](/icons/layout.gif) | Hautzek,S. - Hawk,G.pdf | 2015-03-18 13:55 | 969K | |
![[ ]](/icons/layout.gif) | Hawk Industries - Ha..> | 2015-03-18 13:55 | 812K | |
![[ ]](/icons/layout.gif) | Hawley,F. - Hayden,J..> | 2015-03-18 13:56 | 864K | |
![[ ]](/icons/layout.gif) | Hayden,J.,Jr. - Haye..> | 2015-03-18 13:57 | 797K | |
![[ ]](/icons/layout.gif) | Hayes,F. - Hayling,W..> | 2015-03-18 13:57 | 770K | |
![[ ]](/icons/layout.gif) | Haymaker,Agent,F. P...> | 2015-03-18 13:58 | 825K | |
![[ ]](/icons/layout.gif) | Hazel,F. - Healing,D..> | 2015-03-18 13:59 | 950K | |
![[ ]](/icons/layout.gif) | Healing,D - H. E. W..> | 2015-03-18 13:59 | 804K | |
![[ ]](/icons/layout.gif) | Hearst Corp. - Hebda..> | 2015-03-18 14:00 | 926K | |
![[ ]](/icons/layout.gif) | Hebda,H. - Heckel,L.pdf | 2015-03-18 14:01 | 1.2M | |
![[ ]](/icons/layout.gif) | Heckel, L. - Heeson,..> | 2015-03-18 14:02 | 1.1M | |
![[ ]](/icons/layout.gif) | Heff,B. - Heiderich,..> | 2015-03-18 14:02 | 926K | |
![[ ]](/icons/layout.gif) | Heiderman,F. - Heima..> | 2015-03-18 14:03 | 1.1M | |
![[ ]](/icons/layout.gif) | Heimann,J. - Heinric..> | 2015-03-18 14:04 | 1.2M | |
![[ ]](/icons/layout.gif) | Heinrich, (Trooper) ..> | 2015-03-18 14:04 | 1.3M | |
![[ ]](/icons/layout.gif) | Heitemeyer,R - Helen..> | 2015-03-18 14:05 | 965K | |
![[ ]](/icons/layout.gif) | Helfich,G. - Heller,..> | 2015-03-18 14:06 | 1.0M | |
![[ ]](/icons/layout.gif) | Heller,M. - Helm,W.pdf | 2015-03-18 14:07 | 1.1M | |
![[ ]](/icons/layout.gif) | Helm, W., Jr. - Hemm..> | 2015-03-18 14:07 | 895K | |
![[ ]](/icons/layout.gif) | Hemmens,H. J,II-Hend..> | 2015-03-18 14:08 | 1.1M | |
![[ ]](/icons/layout.gif) | Henderson,C. - Hende..> | 2015-03-18 14:09 | 1.0M | |
![[ ]](/icons/layout.gif) | Henderson,R. - Hendr..> | 2015-03-18 14:10 | 929K | |
![[ ]](/icons/layout.gif) | Hendrickson,E. - Hen..> | 2015-03-18 14:10 | 1.0M | |
![[ ]](/icons/layout.gif) | Heningburg, G - Henn..> | 2015-03-18 14:11 | 838K | |
![[ ]](/icons/layout.gif) | Hennessy,J. - Henry,..> | 2015-03-18 14:12 | 1.1M | |
![[ ]](/icons/layout.gif) | Henry,C. - Henry,M.pdf | 2015-03-18 14:13 | 1.1M | |
![[ ]](/icons/layout.gif) | Henry,M. - Hencchel ..> | 2015-03-18 14:14 | 1.0M | |
![[ ]](/icons/layout.gif) | Hensdale,H. - Herber..> | 2015-03-18 14:14 | 1.0M | |
![[ ]](/icons/layout.gif) | Herbert,A. - Hercule..> | 2015-03-18 14:15 | 1.0M | |
![[ ]](/icons/layout.gif) | Hercules, Inc - Heri..> | 2015-03-18 14:16 | 935K | |
![[ ]](/icons/layout.gif) | Heritage's Dairy, In..> | 2015-03-18 14:17 | 713K | |
![[ ]](/icons/layout.gif) | Heritage Bank-North,..> | 2015-03-18 14:17 | 953K | |
![[ ]](/icons/layout.gif) | Herman,J. - Hermica ..> | 2015-03-18 14:18 | 916K | |
![[ ]](/icons/layout.gif) | Herod,W - Herrick,Jr..> | 2015-03-18 14:19 | 1.3M | |
![[ ]](/icons/layout.gif) | Herrick,M. - Hersh,M..> | 2015-03-18 14:20 | 1.0M | |
![[ ]](/icons/layout.gif) | Hersh,M. - Hertz Ren..> | 2015-03-18 14:20 | 935K | |
![[ ]](/icons/layout.gif) | Hertex,Inc. - Hose,.pdf | 2015-03-18 14:21 | 1.1M | |
![[ ]](/icons/layout.gif) | Hertz Systems,Inc. -..> | 2015-03-18 14:22 | 1.0M | |
![[ ]](/icons/layout.gif) | Hess,M. - Hessert T...> | 2015-03-18 14:23 | 828K | |
![[ ]](/icons/layout.gif) | Hess Agency,Inc. - H..> | 2015-03-18 14:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Hessington,R. - Heuv..> | 2015-03-18 14:24 | 900K | |
![[ ]](/icons/layout.gif) | Heuval,P. - Heyman,B..> | 2015-03-18 14:25 | 883K | |
![[ ]](/icons/layout.gif) | Heyman,B. - Hickey,G..> | 2015-03-18 14:27 | 1.1M | |
![[ ]](/icons/layout.gif) | Hickey, G - Hicks,G.pdf | 2015-03-18 14:27 | 942K | |
![[ ]](/icons/layout.gif) | Hicks,G. & Hicks,P. ..> | 2015-03-18 14:28 | 728K | |
![[ ]](/icons/layout.gif) | Hidden Valley Ranch ..> | 2015-03-18 14:29 | 768K | |
![[ ]](/icons/layout.gif) | Higgins,D. - High,G.pdf | 2015-03-18 14:30 | 922K | |
![[ ]](/icons/layout.gif) | High,G. - Highway Li..> | 2015-03-18 14:30 | 961K | |
![[ ]](/icons/layout.gif) | Highway Lighthouse C..> | 2015-03-18 14:31 | 1.1M | |
![[ ]](/icons/layout.gif) | Hilderman,A. - Hill,..> | 2015-03-18 14:32 | 1.0M | |
![[ ]](/icons/layout.gif) | Hill,D. - Hill,K.pdf | 2015-03-18 14:33 | 1.0M | |
![[ ]](/icons/layout.gif) | Hill,K. - Hill,W.pdf | 2015-03-18 14:33 | 904K | |
![[ ]](/icons/layout.gif) | Hill,W. - Hillman,G.pdf | 2015-03-18 14:34 | 1.1M | |
![[ ]](/icons/layout.gif) | Hillman,G. - Hills &..> | 2015-03-18 14:35 | 1.2M | |
![[ ]](/icons/layout.gif) | Hills Dept. Store,In..> | 2015-03-18 14:36 | 1.2M | |
![[ ]](/icons/layout.gif) | Hilton,G. - Hilton,G..> | 2015-03-18 14:37 | 1.3M | |
![[ ]](/icons/layout.gif) | Hilton,G. - Hinchman..> | 2015-03-18 14:38 | 1.0M | |
![[ ]](/icons/layout.gif) | Hinck,A. - Hines,W.,..> | 2015-03-18 14:39 | 1.5M | |
![[ ]](/icons/layout.gif) | Hines,W.,Dir. Gen. o..> | 2015-03-18 14:40 | 2.5M | |
![[ ]](/icons/layout.gif) | Hinricks,H. - Hirsch..> | 2015-03-18 14:41 | 1.4M | |
![[ ]](/icons/layout.gif) | Hirsch,G. - Hirschma..> | 2015-03-18 14:42 | 1.2M | |
![[ ]](/icons/layout.gif) | Hirschman,A. - Hitt,..> | 2015-03-18 14:42 | 1.1M | |
![[ ]](/icons/layout.gif) | Hitt,M. - Hoban,M.pdf | 2015-03-18 14:43 | 1.1M | |
![[ ]](/icons/layout.gif) | Hoban,M. - Hoboken M..> | 2015-03-18 14:44 | 1.1M | |
![[ ]](/icons/layout.gif) | Hoboken Mfgs' . R.R...> | 2015-03-18 14:45 | 1.3M | |
![[ ]](/icons/layout.gif) | Hockhold,J. - Hodgki..> | 2015-03-18 14:46 | 1.0M | |
![[ ]](/icons/layout.gif) | Hodkiss,R. - Hoefler..> | 2015-03-18 14:46 | 934K | |
![[ ]](/icons/layout.gif) | Hoefling,J. - Hoff,S..> | 2015-03-18 14:47 | 1.2M | |
![[ ]](/icons/layout.gif) | Hoff,V. - Hoffman,B...> | 2015-03-18 14:48 | 788K | |
![[ ]](/icons/layout.gif) | Hoffman,B. - Hoffman..> | 2015-03-18 14:49 | 1.2M | |
![[ ]](/icons/layout.gif) | Hoffman,H. - Hoffman..> | 2015-03-18 14:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Hoffman,S. - Hofling..> | 2015-03-18 14:51 | 1.2M | |
![[ ]](/icons/layout.gif) | Hoffman - Laroche In..> | 2015-03-18 14:49 | 1.1M | |
![[ ]](/icons/layout.gif) | Hofling,V. - Hogan,T..> | 2015-03-18 14:52 | 1.5M | |
![[ ]](/icons/layout.gif) | Hogan,T. - Hohns,M.pdf | 2015-03-18 14:53 | 1.4M | |
![[ ]](/icons/layout.gif) | Hohnstine,J. - Holde..> | 2015-03-18 14:54 | 1.3M | |
![[ ]](/icons/layout.gif) | Holden,I. - Holiday ..> | 2015-03-18 14:54 | 1.1M | |
![[ ]](/icons/layout.gif) | Holiday Kitchens,Inc..> | 2015-03-18 14:55 | 1.3M | |
![[ ]](/icons/layout.gif) | Holland,J.,Sheriff -..> | 2015-03-18 14:56 | 1.8M | |
![[ ]](/icons/layout.gif) | Hollander,S. - Holli..> | 2015-03-18 14:57 | 1.3M | |
![[ ]](/icons/layout.gif) | Hollinsworth,J. - Ho..> | 2015-03-18 14:58 | 1.1M | |
![[ ]](/icons/layout.gif) | Holly Beach Realty C..> | 2015-03-18 14:59 | 1.6M | |
![[ ]](/icons/layout.gif) | Holmes,C . - Holmes,..> | 2015-03-18 14:59 | 1.9M | |
![[ ]](/icons/layout.gif) | Holmes,M. - Home Sta..> | 2015-03-18 15:00 | 1.9M | |
![[ ]](/icons/layout.gif) | Holst Hofbrau - Holt..> | 2015-03-18 15:01 | 1.5M | |
![[ ]](/icons/layout.gif) | Holt Marire Terminal..> | 2015-03-18 15:02 | 1.6M | |
![[ ]](/icons/layout.gif) | Holuba,S. - Home Imp..> | 2015-03-18 15:03 | 2.1M | |
![[ ]](/icons/layout.gif) | Home Improvement Co...> | 2015-03-18 15:04 | 1.1M | |
![[ ]](/icons/layout.gif) | Home Investment Corp..> | 2015-03-18 15:04 | 1.2M | |
![[ ]](/icons/layout.gif) | Home Style Foods,Inc..> | 2015-03-18 15:05 | 2.4M | |
![[ ]](/icons/layout.gif) | Hong,C. - Hook,R.pdf | 2015-03-18 15:06 | 1.8M | |
![[ ]](/icons/layout.gif) | Hook,W. - Holst,G.,J..> | 2015-03-18 15:07 | 2.1M | |
![[ ]](/icons/layout.gif) | Hopfel,A. - Hoppach,..> | 2015-03-18 15:08 | 1.3M | |
![[ ]](/icons/layout.gif) | Hoppe,C. - Horby,Mrs..> | 2015-03-18 15:09 | 1.3M | |
![[ ]](/icons/layout.gif) | Horchak,J.,Jr. - Hor..> | 2015-03-18 15:09 | 1.1M | |
![[ ]](/icons/layout.gif) | Horn,J. - Horner,C.pdf | 2015-03-18 15:10 | 1.1M | |
![[ ]](/icons/layout.gif) | Horner,C. - Horner,R..> | 2015-03-18 15:11 | 1.6M | |
![[ ]](/icons/layout.gif) | Horner,R. - Horowitz..> | 2015-03-18 15:12 | 1.3M | |
![[ ]](/icons/layout.gif) | Horowitz,B. - Horten..> | 2015-03-18 15:13 | 1.3M | |
![[ ]](/icons/layout.gif) | Hose,L. - Hotalin's ..> | 2015-03-18 15:13 | 1.0M | |
![[ ]](/icons/layout.gif) | Hotaling's Boat Yard..> | 2015-03-18 15:14 | 1.4M | |
![[ ]](/icons/layout.gif) | Houbigant,Inc. - Hou..> | 2015-03-18 15:15 | 1.3M | |
![[ ]](/icons/layout.gif) | House,E. - Housing A..> | 2015-03-18 15:16 | 956K | |
![[ ]](/icons/layout.gif) | Housing Auth. of The..> | 2015-03-18 15:16 | 1.1M | |
![[ ]](/icons/layout.gif) | Howard,B. - Howard,J..> | 2015-03-18 15:18 | 1.3M | |
![[ ]](/icons/layout.gif) | Howard,J. - Howard,W..> | 2015-03-18 15:19 | 1.4M | |
![[ ]](/icons/layout.gif) | Howard,W. - Howell,E..> | 2015-03-18 15:19 | 1.6M | |
![[ ]](/icons/layout.gif) | Howard Johnson Motor..> | 2015-03-18 15:17 | 1.3M | |
![[ ]](/icons/layout.gif) | Howell,E. - Howly,L.pdf | 2015-03-18 15:20 | 1.2M | |
![[ ]](/icons/layout.gif) | Howey,R. - Hoynash,L..> | 2015-03-18 15:21 | 1.2M | |
![[ ]](/icons/layout.gif) | Hoyne Industries,Inc..> | 2015-03-18 15:22 | 1.6M | |
![[ ]](/icons/layout.gif) | Hubbard,B. - Huber,J..> | 2015-03-18 15:23 | 1.2M | |
![[ ]](/icons/layout.gif) | Huber,J. - Huck-Gerh..> | 2015-03-18 15:23 | 1.0M | |
![[ ]](/icons/layout.gif) | Huck-Gerhardt Co.,In..> | 2015-03-18 15:26 | 2.9M | |
![[ ]](/icons/layout.gif) | Hudson,Matress Mfg. ..> | 2015-03-18 15:29 | 1.2M | |
![[ ]](/icons/layout.gif) | Hudson County Bd. of..> | 2015-03-18 15:26 | 1.3M | |
![[ ]](/icons/layout.gif) | Hudson Dispatch Co.,..> | 2015-03-18 15:27 | 1.2M | |
![[ ]](/icons/layout.gif) | Hudson Transit Lines..> | 2015-03-18 15:28 | 1.0M | |
![[ ]](/icons/layout.gif) | Huff,W. - Hughes,D.pdf | 2015-03-18 15:30 | 950K | |
![[ ]](/icons/layout.gif) | Huges,D. - Hughes,J...> | 2015-03-18 15:30 | 1.2M | |
![[ ]](/icons/layout.gif) | Hughes,Hon.P. - Hule..> | 2015-03-18 15:31 | 1.0M | |
![[ ]](/icons/layout.gif) | Hughes,J.,Act Commis..> | 2015-03-18 15:32 | 972K | |
![[ ]](/icons/layout.gif) | Hulibeg,R. - Humane ..> | 2015-03-18 15:33 | 1.1M | |
![[ ]](/icons/layout.gif) | Humane Soc. of the U..> | 2015-03-18 15:33 | 1.0M | |
![[ ]](/icons/layout.gif) | Humphrey,F. - Hunt,A..> | 2015-03-18 15:34 | 1.2M | |
![[ ]](/icons/layout.gif) | Hunt,R.W.Co - Hunter..> | 2015-03-18 15:35 | 1.4M | |
![[ ]](/icons/layout.gif) | Hunt Assoc.,Inc. - H..> | 2015-03-18 15:35 | 923K | |
![[ ]](/icons/layout.gif) | Hunter,J. - Huntley,..> | 2015-03-18 15:36 | 1.2M | |
![[ ]](/icons/layout.gif) | Huntley,C. - Hurley,..> | 2015-03-18 15:37 | 2.8M | |
![[ ]](/icons/layout.gif) | Hurley,J., Act. Dir...> | 2015-03-18 15:38 | 2.5M | |
![[ ]](/icons/layout.gif) | Husan,W. - Hutchinso..> | 2015-03-18 15:39 | 2.7M | |
![[ ]](/icons/layout.gif) | Hutchinson,A. - Hutt..> | 2015-03-18 15:40 | 2.4M | |
![[ ]](/icons/layout.gif) | Hutton,E. F. - Hyde ..> | 2015-03-18 15:41 | 1.7M | |
![[ ]](/icons/layout.gif) | Hyde,R.,Jr. - Hygrad..> | 2015-03-18 15:42 | 2.1M | |
![[ ]](/icons/layout.gif) | Hygrade Sylvania Cor..> | 2015-03-18 15:42 | 1.9M | |
![[ ]](/icons/layout.gif) | Hyman,C. - Hynson,G.pdf | 2015-03-18 15:43 | 2.2M | |
![[ ]](/icons/layout.gif) | Hynson,L. - I.S.D. E..> | 2015-03-18 15:44 | 1.4M | |
![[ ]](/icons/layout.gif) | I.R.S. - Int. Assoc ..> | 2015-03-18 15:45 | 1.9M | |
![[ ]](/icons/layout.gif) | I.S.D. Electronics,I..> | 2015-03-18 15:46 | 1.1M | |
![[ ]](/icons/layout.gif) | Iannacone,G. - Ingeb..> | 2015-03-18 15:47 | 1.5M | |
![[ ]](/icons/layout.gif) | Iannuci,P. - Ideal F..> | 2015-03-18 15:48 | 1.9M | |
![[ ]](/icons/layout.gif) | Ideal Farms,Inc. - I..> | 2015-03-18 15:49 | 2.1M | |
![[ ]](/icons/layout.gif) | Ignatowitz,A. - Ills..> | 2015-03-18 15:49 | 1.9M | |
![[ ]](/icons/layout.gif) | Illumination Indust...> | 2015-03-18 15:50 | 1.9M | |
![[ ]](/icons/layout.gif) | Imperial Chemical In..> | 2015-03-18 15:51 | 1.0M | |
![[ ]](/icons/layout.gif) | Incandela,J. - Ind. ..> | 2015-03-18 15:52 | 2.5M | |
![[ ]](/icons/layout.gif) | Ind. Lab. Employees ..> | 2015-03-18 15:53 | 2.2M | |
![[ ]](/icons/layout.gif) | Industrial Bank of C..> | 2015-03-18 15:54 | 1.4M | |
![[ ]](/icons/layout.gif) | Industrial Un. of Ma..> | 2015-03-18 15:55 | 1.7M | |
![[ ]](/icons/layout.gif) | Ingelbretson,I.,Clai..> | 2015-03-18 15:56 | 1.6M | |
![[ ]](/icons/layout.gif) | Ingraham,G. - Inman,..> | 2015-03-18 15:57 | 2.4M | |
![[ ]](/icons/layout.gif) | Inman,M. (Off.) - In..> | 2015-03-18 15:57 | 1.3M | |
![[ ]](/icons/layout.gif) | Ins. Co. of North Am..> | 2015-03-18 15:58 | 1.7M | |
![[ ]](/icons/layout.gif) | Inslee,S. - Ins. Co...> | 2015-03-18 15:59 | 1.1M | |
![[ ]](/icons/layout.gif) | Int. Assoc. of Machi..> | 2015-03-18 16:00 | 1.9M | |
![[ ]](/icons/layout.gif) | Int. Brotherhood of ..> | 2015-03-18 16:01 | 1.1M | |
![[ ]](/icons/layout.gif) | Int. Brotherhood of ..> | 2015-03-18 16:02 | 1.4M | |
![[ ]](/icons/layout.gif) | Int. Brotherhood of ..> | 2015-03-18 16:03 | 1.8M | |
![[ ]](/icons/layout.gif) | Int. Fid. Ins. Co. -..> | 2015-03-18 16:04 | 1.9M | |
![[ ]](/icons/layout.gif) | Int. Industrial Work..> | 2015-03-18 16:05 | 1.0M | |
![[ ]](/icons/layout.gif) | Int.Loadstar - Int. ..> | 2015-03-18 16:10 | 2.0M | |
![[ ]](/icons/layout.gif) | Int. Re-Ins. Corp. -..> | 2015-03-18 16:06 | 2.4M | |
![[ ]](/icons/layout.gif) | Int. Tel. & Teleg. C..> | 2015-03-18 16:07 | 1.5M | |
![[ ]](/icons/layout.gif) | Int. Un. of Elec. Ra..> | 2015-03-18 16:08 | 1.1M | |
![[ ]](/icons/layout.gif) | Int. Un. of Operatin..> | 2015-03-18 16:09 | 2.6M | |
![[ ]](/icons/layout.gif) | Inter-Co. Tile Guar...> | 2015-03-18 16:11 | 2.2M | |
![[ ]](/icons/layout.gif) | Interstate Commerce ..> | 2015-03-18 16:12 | 3.7M | |
![[ ]](/icons/layout.gif) | Interstate Motel Cor..> | 2015-03-18 16:13 | 4.3M | |
![[ ]](/icons/layout.gif) | Interstate No. 2 - I..> | 2015-03-18 16:14 | 2.4M | |
![[ ]](/icons/layout.gif) | Intile,J. - Ionan Le..> | 2015-03-18 16:15 | 1.9M | |
![[ ]](/icons/layout.gif) | Ionian Messenger - I..> | 2015-03-18 16:15 | 1.8M | |
![[ ]](/icons/layout.gif) | Ira Realty Co. - Iri..> | 2015-03-18 16:16 | 2.4M | |
![[ ]](/icons/layout.gif) | Irlid,M. - Irving,H.pdf | 2015-03-18 16:17 | 3.3M | |
![[ ]](/icons/layout.gif) | Irving Improvement C..> | 2015-03-18 16:18 | 1.9M | |
![[ ]](/icons/layout.gif) | Irwin,Mary - Iselbor..> | 2015-03-18 16:19 | 2.4M | |
![[ ]](/icons/layout.gif) | Iselborn,Jacob - Iso..> | 2015-03-18 16:20 | 2.3M | |
![[ ]](/icons/layout.gif) | Isolantite Mfg. - It..> | 2015-03-18 16:21 | 2.0M | |
![[ ]](/icons/layout.gif) | Italiano,F. - Iverso..> | 2015-03-18 16:21 | 1.3M | |
![[ ]](/icons/layout.gif) | Iverson,L. - J.B.Ma..> | 2015-03-18 16:22 | 1.8M | |
![[ ]](/icons/layout.gif) | J.B. Redding & Son.,..> | 2015-03-18 16:23 | 1.0M | |
![[ ]](/icons/layout.gif) | J.S.107 Stores, Inc...> | 2015-03-18 16:24 | 1.5M | |
![[ ]](/icons/layout.gif) | Jack's Restaurant - ..> | 2015-03-18 16:24 | 1.6M | |
![[ ]](/icons/layout.gif) | Jackson, J. - Jackso..> | 2015-03-18 16:27 | 1.3M | |
![[ ]](/icons/layout.gif) | Jackson,M. - Jackson..> | 2015-03-18 16:27 | 1.2M | |
![[ ]](/icons/layout.gif) | Jackson,W. - Jacobs,..> | 2015-03-18 16:28 | 1.1M | |
![[ ]](/icons/layout.gif) | Jackson Brokerage Co..> | 2015-03-18 16:25 | 1.4M | |
![[ ]](/icons/layout.gif) | Jackson Packing Co. ..> | 2015-03-18 16:26 | 1.3M | |
![[ ]](/icons/layout.gif) | Jacobs,A. - Jacobs, ..> | 2015-03-18 16:30 | 1.6M | |
![[ ]](/icons/layout.gif) | Jacobs, J. - Jacobse..> | 2015-03-18 16:29 | 1.6M | |
![[ ]](/icons/layout.gif) | Jacobsen,H. - Jacobs..> | 2015-03-18 16:31 | 1.4M | |
![[ ]](/icons/layout.gif) | Jacobsen,S. - Jaeger..> | 2015-03-18 16:32 | 1.7M | |
![[ ]](/icons/layout.gif) | Jaeger,H. - Jagemann..> | 2015-03-18 16:32 | 1.8M | |
![[ ]](/icons/layout.gif) | Jagemann,G. - Jalkie..> | 2015-03-18 16:33 | 2.4M | |
![[ ]](/icons/layout.gif) | Jalkiewicz,T. - Jame..> | 2015-03-18 16:34 | 1.9M | |
![[ ]](/icons/layout.gif) | James, J. - Jameson,..> | 2015-03-18 16:35 | 1.4M | |
![[ ]](/icons/layout.gif) | Jameson,C. - Jang,C.pdf | 2015-03-18 16:36 | 1.8M | |
![[ ]](/icons/layout.gif) | Jangarathis,J. - Jan..> | 2015-03-18 16:37 | 2.2M | |
![[ ]](/icons/layout.gif) | Janoski,P. - Jaquith..> | 2015-03-18 16:37 | 2.9M | |
![[ ]](/icons/layout.gif) | Jara,J. - Jarosz,V.pdf | 2015-03-18 16:38 | 2.7M | |
![[ ]](/icons/layout.gif) | Jaroszewski,J. - Jau..> | 2015-03-18 16:39 | 2.3M | |
![[ ]](/icons/layout.gif) | Jauregui,C. - Jazz B..> | 2015-03-18 16:40 | 1.8M | |
![[ ]](/icons/layout.gif) | Jazz Enterprises - J..> | 2015-03-18 16:41 | 1.5M | |
![[ ]](/icons/layout.gif) | Jefferies,V. - Jems ..> | 2015-03-18 16:42 | 2.1M | |
![[ ]](/icons/layout.gif) | Jefferson,K. - Jeffe..> | 2015-03-18 16:43 | 1.5M | |
![[ ]](/icons/layout.gif) | Jemson,B. - Jenkins,..> | 2015-03-18 16:43 | 1.5M | |
![[ ]](/icons/layout.gif) | Jenkins, J. - Jennie..> | 2015-03-18 16:44 | 1.3M | |
![[ ]](/icons/layout.gif) | Jennie Dress Inc. - ..> | 2015-03-18 16:45 | 2.3M | |
![[ ]](/icons/layout.gif) | Jensen,D. - Jerrell,..> | 2015-03-18 16:46 | 2.9M | |
![[ ]](/icons/layout.gif) | Jerrell,S. - Jersey ..> | 2015-03-18 16:47 | 2.5M | |
![[ ]](/icons/layout.gif) | Jersey City - Dept. ..> | 2015-03-18 16:48 | 2.4M | |
![[ ]](/icons/layout.gif) | Jersey City Publishi..> | 2015-03-18 16:49 | 1.4M | |
![[ ]](/icons/layout.gif) | Jersey Publishing Co..> | 2015-03-18 16:49 | 1.6M | |
![[ ]](/icons/layout.gif) | Jeter,G. - Jim,L.pdf | 2015-03-18 16:50 | 1.9M | |
![[ ]](/icons/layout.gif) | Jim,N. - Jobar Chemi..> | 2015-03-18 16:51 | 1.5M | |
![[ ]](/icons/layout.gif) | Jobbers Credit Asso...> | 2015-03-18 16:52 | 1.2M | |
![[ ]](/icons/layout.gif) | Joe,M. - John M.McGr..> | 2015-03-18 16:52 | 2.0M | |
![[ ]](/icons/layout.gif) | John M.McGrath Corp...> | 2015-03-18 16:53 | 1.3M | |
![[ ]](/icons/layout.gif) | Johns-Manville Corp...> | 2015-03-18 16:54 | 1.2M | |
![[ ]](/icons/layout.gif) | Johns-Manville Produ..> | 2015-03-18 16:55 | 790K | |
![[ ]](/icons/layout.gif) | Johns-Manville Sales..> | 2015-03-18 16:55 | 1.3M | |
![[ ]](/icons/layout.gif) | Johnson & Johnson - ..> | 2015-03-18 16:56 | 1.5M | |
![[ ]](/icons/layout.gif) | Johnson,A. - Johnson..> | 2015-03-18 16:57 | 2.1M | |
![[ ]](/icons/layout.gif) | Johnson,B. - Johnson..> | 2015-03-18 16:58 | 1.6M | |
![[ ]](/icons/layout.gif) | Johnson,C. - Johnson..> | 2015-03-18 16:59 | 1.4M | |
![[ ]](/icons/layout.gif) | Johnson,E. - Johnson..> | 2015-03-18 16:59 | 1.7M | |
![[ ]](/icons/layout.gif) | Johnson,G. - Johnson..> | 2015-03-18 17:00 | 1.5M | |
![[ ]](/icons/layout.gif) | Johnson,J. - Johnson..> | 2015-03-18 17:01 | 1.6M | |
![[ ]](/icons/layout.gif) | Johnson,L. - Johnson..> | 2015-03-18 17:02 | 1.3M | |
![[ ]](/icons/layout.gif) | Johnson,M. - Johnson..> | 2015-03-18 17:02 | 1.9M | |
![[ ]](/icons/layout.gif) | Johnson,R. - Johnson..> | 2015-03-18 17:03 | 1.2M | |
![[ ]](/icons/layout.gif) | Johnson,S. - Johnson..> | 2015-03-18 17:04 | 1.5M | |
![[ ]](/icons/layout.gif) | Johnson,W. - Johnsto..> | 2015-03-18 17:05 | 1.6M | |
![[ ]](/icons/layout.gif) | Johnston,E. - Jekewi..> | 2015-03-18 17:05 | 1.6M | |
![[ ]](/icons/layout.gif) | Jokufel,S.S. - Jones..> | 2015-03-18 17:06 | 1.7M | |
![[ ]](/icons/layout.gif) | Jones,A. - Jones,C.pdf | 2015-03-18 17:07 | 1.2M | |
![[ ]](/icons/layout.gif) | Jones,C. - Jones,E.pdf | 2015-03-18 17:08 | 1.1M | |
![[ ]](/icons/layout.gif) | Jones,E. - Jones,H.pdf | 2015-03-18 17:08 | 1.8M | |
![[ ]](/icons/layout.gif) | Jones,H. - Jones,J.pdf | 2015-03-18 17:09 | 1.7M | |
![[ ]](/icons/layout.gif) | Jones,J. - Jones,L.pdf | 2015-03-18 17:10 | 1.5M | |
![[ ]](/icons/layout.gif) | Jones,L. - Jones,R.pdf | 2015-03-18 17:11 | 1.1M | |
![[ ]](/icons/layout.gif) | Jones,R. - Jones,S.pdf | 2015-03-18 17:11 | 808K | |
![[ ]](/icons/layout.gif) | Jones,T. - Jones,W.pdf | 2015-03-18 17:12 | 1.5M | |
![[ ]](/icons/layout.gif) | Jones,W. - Jordan,E.pdf | 2015-03-18 17:13 | 1.2M | |
![[ ]](/icons/layout.gif) | Jordan,G. - Jordan,T..> | 2015-03-18 17:14 | 1.3M | |
![[ ]](/icons/layout.gif) | Jordan,T. - Joseph,J..> | 2015-03-18 17:15 | 1.5M | |
![[ ]](/icons/layout.gif) | Joseph,J. - Journal ..> | 2015-03-18 17:16 | 1.7M | |
![[ ]](/icons/layout.gif) | Journal Square Taxi ..> | 2015-03-18 17:16 | 1.2M | |
![[ ]](/icons/layout.gif) | Joynes,T. - Jugtown ..> | 2015-03-18 17:17 | 1.5M | |
![[ ]](/icons/layout.gif) | Juhasz,A. - Juliano,..> | 2015-03-18 17:18 | 1.7M | |
![[ ]](/icons/layout.gif) | Juliano,J. - Juno Co..> | 2015-03-18 17:19 | 1.7M | |
![[ ]](/icons/layout.gif) | Juno Construction Co..> | 2015-03-18 17:20 | 1.3M | |
![[ ]](/icons/layout.gif) | Justice,R. - K.R. Se..> | 2015-03-18 17:21 | 1.1M | |
![[ ]](/icons/layout.gif) | KRC Research,Inc. - ..> | 2015-03-18 18:54 | 1.6M | |
![[ ]](/icons/layout.gif) | Kaczorowski,S. - Kah..> | 2015-03-18 17:22 | 1.9M | |
![[ ]](/icons/layout.gif) | Kahle,J. - Kain,G.pdf | 2015-03-18 17:22 | 1.4M | |
![[ ]](/icons/layout.gif) | Kain,G. - Kalantzis,..> | 2015-03-18 17:23 | 1.8M | |
![[ ]](/icons/layout.gif) | Kalapus,J. - Kalker,..> | 2015-03-18 17:24 | 1.8M | |
![[ ]](/icons/layout.gif) | Kalkman,E. - Kaltz,J..> | 2015-03-18 17:25 | 1.2M | |
![[ ]](/icons/layout.gif) | Kaltz,J. - Kaminsky,..> | 2015-03-18 17:26 | 1.4M | |
![[ ]](/icons/layout.gif) | Kaminsky,P. - Kandol..> | 2015-03-18 17:26 | 1.6M | |
![[ ]](/icons/layout.gif) | Kandravy,A. - Kane,M..> | 2015-03-18 17:27 | 2.6M | |
![[ ]](/icons/layout.gif) | Kane-Miller Corp. - ..> | 2015-03-18 17:28 | 1.6M | |
![[ ]](/icons/layout.gif) | Kanick,J. - Kapec,W.pdf | 2015-03-18 17:29 | 1.3M | |
![[ ]](/icons/layout.gif) | Kapelowicz,I. - Kapl..> | 2015-03-18 17:29 | 902K | |
![[ ]](/icons/layout.gif) | Kaplan,D. - Kaplan,J..> | 2015-03-18 17:30 | 1.6M | |
![[ ]](/icons/layout.gif) | Kaplan,J. - Katchen,..> | 2015-03-18 17:31 | 1.2M | |
![[ ]](/icons/layout.gif) | Kaplan,S. - Kapura,A..> | 2015-03-18 17:32 | 1.4M | |
![[ ]](/icons/layout.gif) | Kapura,A. - Karchmar..> | 2015-03-18 17:32 | 884K | |
![[ ]](/icons/layout.gif) | Karck,A. - Kanick,J.pdf | 2015-03-18 17:33 | 1.2M | |
![[ ]](/icons/layout.gif) | Karpack,M. - Kascho,..> | 2015-03-18 17:34 | 1.5M | |
![[ ]](/icons/layout.gif) | Kasden,E. - Kasprak,..> | 2015-03-18 17:35 | 1.6M | |
![[ ]](/icons/layout.gif) | Kasprak,S. - Katzenb..> | 2015-03-18 17:36 | 1.8M | |
![[ ]](/icons/layout.gif) | Katchen Iron Works -..> | 2015-03-18 17:36 | 1.3M | |
![[ ]](/icons/layout.gif) | Katenberg & Org.Inc...> | 2015-03-18 17:37 | 2.4M | |
![[ ]](/icons/layout.gif) | Katz,A. - Katz,I.pdf | 2015-03-18 17:38 | 1.5M | |
![[ ]](/icons/layout.gif) | Katz,I. - Karp,Z.pdf | 2015-03-18 17:39 | 1.4M | |
![[ ]](/icons/layout.gif) | Kauffman,S.,D.O. - K..> | 2015-03-18 17:40 | 2.5M | |
![[ ]](/icons/layout.gif) | Kaufman,M. - Kavchak..> | 2015-03-18 17:40 | 1.0M | |
![[ ]](/icons/layout.gif) | Kavert,A. - Kay,S.pdf | 2015-03-18 17:41 | 1.3M | |
![[ ]](/icons/layout.gif) | Kay,S.,Prin. - Kazin..> | 2015-03-18 17:42 | 1.1M | |
![[ ]](/icons/layout.gif) | Kazlaiskas,J. - Kean..> | 2015-03-18 17:43 | 1.4M | |
![[ ]](/icons/layout.gif) | Keansburg Steamboat ..> | 2015-03-18 17:44 | 1.3M | |
![[ ]](/icons/layout.gif) | Kearny Post Office B..> | 2015-03-18 17:44 | 1.2M | |
![[ ]](/icons/layout.gif) | Kedian,W.,Jr. - Keel..> | 2015-03-18 17:45 | 1.9M | |
![[ ]](/icons/layout.gif) | Keeler,E. - Keenan,M..> | 2015-03-18 17:46 | 2.4M | |
![[ ]](/icons/layout.gif) | Keenan,M. - Keeton,E..> | 2015-03-18 17:47 | 1.4M | |
![[ ]](/icons/layout.gif) | Keeton,E. Lorry - Ke..> | 2015-03-18 17:48 | 1.8M | |
![[ ]](/icons/layout.gif) | Keim,C. - Kelchner,C..> | 2015-03-18 17:49 | 1.6M | |
![[ ]](/icons/layout.gif) | Keljikan,R. - Keller..> | 2015-03-18 17:50 | 2.2M | |
![[ ]](/icons/layout.gif) | Keller,S. - Kelley,O..> | 2015-03-18 17:50 | 1.6M | |
![[ ]](/icons/layout.gif) | Kelley,O. - Kelly,C.pdf | 2015-03-18 17:51 | 1.9M | |
![[ ]](/icons/layout.gif) | Kelly,C. - Kelly,W.pdf | 2015-03-18 17:54 | 1.3M | |
![[ ]](/icons/layout.gif) | Kelly,G. - Kelly,Jr...> | 2015-03-18 17:54 | 1.8M | |
![[ ]](/icons/layout.gif) | Kelly,II,W. - Kelter..> | 2015-03-18 17:55 | 1.9M | |
![[ ]](/icons/layout.gif) | Kelly Assoc.,Inc.,J...> | 2015-03-18 17:52 | 2.1M | |
![[ ]](/icons/layout.gif) | Kelly Constr Co.Inc...> | 2015-03-18 17:53 | 1.4M | |
![[ ]](/icons/layout.gif) | Kelter,M. - Kemper C..> | 2015-03-18 17:56 | 1.6M | |
![[ ]](/icons/layout.gif) | Kemper,E.III - Kenin..> | 2015-03-18 17:57 | 1.5M | |
![[ ]](/icons/layout.gif) | Kenin,L. - Kennedy,H..> | 2015-03-18 17:57 | 1.5M | |
![[ ]](/icons/layout.gif) | Kennedy,R. - Kenney,..> | 2015-03-18 17:58 | 1.9M | |
![[ ]](/icons/layout.gif) | Kenney,W. - Keno,C.pdf | 2015-03-18 17:59 | 1.6M | |
![[ ]](/icons/layout.gif) | Keno,C. - Kenton,A.pdf | 2015-03-18 18:00 | 1.5M | |
![[ ]](/icons/layout.gif) | Kenton Corp. - Kepco..> | 2015-03-18 18:01 | 1.7M | |
![[ ]](/icons/layout.gif) | Kephart,R. - Kern,S.pdf | 2015-03-18 18:01 | 2.4M | |
![[ ]](/icons/layout.gif) | Kern,S. - Kerr,D.pdf | 2015-03-18 18:02 | 2.2M | |
![[ ]](/icons/layout.gif) | Kerr,D. - Kersten Sh..> | 2015-03-18 18:03 | 1.8M | |
![[ ]](/icons/layout.gif) | Kerstetter,R. - Kess..> | 2015-03-18 18:04 | 2.0M | |
![[ ]](/icons/layout.gif) | Kessler,A. - Keswani..> | 2015-03-18 18:04 | 1.9M | |
![[ ]](/icons/layout.gif) | Keszkosky,W. - Kevtr..> | 2015-03-18 18:05 | 1.8M | |
![[ ]](/icons/layout.gif) | Kew,D. - Keyser,W.,J..> | 2015-03-18 18:06 | 2.4M | |
![[ ]](/icons/layout.gif) | Keystone Adjustable ..> | 2015-03-18 18:07 | 1.7M | |
![[ ]](/icons/layout.gif) | Khoury E. - Kiddie C..> | 2015-03-18 18:08 | 1.6M | |
![[ ]](/icons/layout.gif) | Kiddie Glove Corp. -..> | 2015-03-18 18:08 | 1.7M | |
![[ ]](/icons/layout.gif) | Kieran Car & Truck L..> | 2015-03-18 18:09 | 1.7M | |
![[ ]](/icons/layout.gif) | Kiken,C. - Kilkenny,..> | 2015-03-18 18:10 | 3.9M | |
![[ ]](/icons/layout.gif) | Kilkenny,W. - Kilsdo..> | 2015-03-18 18:11 | 1.5M | |
![[ ]](/icons/layout.gif) | Kilson,M. - Kimelman..> | 2015-03-18 18:12 | 1.7M | |
![[ ]](/icons/layout.gif) | Kimeelman,H. - Kind,..> | 2015-03-18 18:12 | 2.3M | |
![[ ]](/icons/layout.gif) | Kind,O. - King,C.pdf | 2015-03-18 18:13 | 3.9M | |
![[ ]](/icons/layout.gif) | King,C. - King,I.pdf | 2015-03-18 18:14 | 3.9M | |
![[ ]](/icons/layout.gif) | King,I. - King,Mr.pdf | 2015-03-18 18:15 | 3.8M | |
![[ ]](/icons/layout.gif) | King,M. - King,W.pdf | 2015-03-18 18:16 | 2.4M | |
![[ ]](/icons/layout.gif) | King,W. - Kingston H..> | 2015-03-18 18:16 | 1.6M | |
![[ ]](/icons/layout.gif) | Kingston Housing Cor..> | 2015-03-18 18:17 | 2.3M | |
![[ ]](/icons/layout.gif) | Kinni,D. - Kipus,W.pdf | 2015-03-18 18:18 | 2.6M | |
![[ ]](/icons/layout.gif) | Kirally,S. - Kirk,M.pdf | 2015-03-18 18:19 | 1.4M | |
![[ ]](/icons/layout.gif) | Kirk,J. - Kirschbaum..> | 2015-03-18 18:20 | 1.2M | |
![[ ]](/icons/layout.gif) | Kirschbaum,P. - Kisl..> | 2015-03-18 18:20 | 1.1M | |
![[ ]](/icons/layout.gif) | Kislak Mtg.Corp.,J.I..> | 2015-03-18 18:21 | 1.0M | |
![[ ]](/icons/layout.gif) | Kitchen,W. - Kivitz,..> | 2015-03-18 18:22 | 1.1M | |
![[ ]](/icons/layout.gif) | Kizee,C. - Klausner,..> | 2015-03-18 18:23 | 1.8M | |
![[ ]](/icons/layout.gif) | Klausner,J. - Klein,..> | 2015-03-18 18:23 | 1.4M | |
![[ ]](/icons/layout.gif) | Klein,A. - Klein,C.pdf | 2015-03-18 18:24 | 1.1M | |
![[ ]](/icons/layout.gif) | Klein,Cider Co. - Kl..> | 2015-03-18 18:25 | 2.8M | |
![[ ]](/icons/layout.gif) | Klein,L. - Kleinberg..> | 2015-03-18 18:26 | 1.6M | |
![[ ]](/icons/layout.gif) | Kleinburg,J. - Klepp..> | 2015-03-18 18:26 | 1.9M | |
![[ ]](/icons/layout.gif) | Klepper,W. - Kline,F..> | 2015-03-18 18:27 | 2.1M | |
![[ ]](/icons/layout.gif) | Kline,G. - Klinkhame..> | 2015-03-18 18:28 | 1.8M | |
![[ ]](/icons/layout.gif) | Klinkhamer,R. - Kloz..> | 2015-03-18 18:29 | 2.0M | |
![[ ]](/icons/layout.gif) | Kloza,C. - Knapp,J.pdf | 2015-03-18 18:30 | 2.5M | |
![[ ]](/icons/layout.gif) | Knapp,J. - Knight,C.pdf | 2015-03-18 18:31 | 2.3M | |
![[ ]](/icons/layout.gif) | Knight,C. - Knoblauc..> | 2015-03-18 18:32 | 1.7M | |
![[ ]](/icons/layout.gif) | Knoblauch,D. - Knoti..> | 2015-03-18 18:33 | 2.7M | |
![[ ]](/icons/layout.gif) | Knotig,Tony and Co. ..> | 2015-03-18 18:33 | 1.8M | |
![[ ]](/icons/layout.gif) | Kobak,F. - Koch,M.pdf | 2015-03-18 18:34 | 1.7M | |
![[ ]](/icons/layout.gif) | Koch,M. - Koehler,B.pdf | 2015-03-18 18:35 | 2.3M | |
![[ ]](/icons/layout.gif) | Koeler,C. - Koeppe,W..> | 2015-03-18 18:36 | 1.7M | |
![[ ]](/icons/layout.gif) | Koeppel,H. - Kohler,..> | 2015-03-18 18:37 | 1.7M | |
![[ ]](/icons/layout.gif) | Kohler,A. - Koines,C..> | 2015-03-18 18:38 | 1.8M | |
![[ ]](/icons/layout.gif) | Koines,C. - Kole,M.pdf | 2015-03-18 18:38 | 1.6M | |
![[ ]](/icons/layout.gif) | Kole,M. - Kolsun,A.pdf | 2015-03-18 18:39 | 1.9M | |
![[ ]](/icons/layout.gif) | Kolsun Brothers - Ko..> | 2015-03-18 18:40 | 1.4M | |
![[ ]](/icons/layout.gif) | Konigsberg,F. - Kooi..> | 2015-03-18 18:41 | 1.4M | |
![[ ]](/icons/layout.gif) | Kooistra,P. - Koplow..> | 2015-03-18 18:42 | 1.5M | |
![[ ]](/icons/layout.gif) | Koplus,A. - Kordahl,..> | 2015-03-18 18:42 | 1.3M | |
![[ ]](/icons/layout.gif) | Kordell,J. - Kornfel..> | 2015-03-18 18:43 | 1.0M | |
![[ ]](/icons/layout.gif) | Kornfield,C. - Kosco..> | 2015-03-18 18:44 | 1.1M | |
![[ ]](/icons/layout.gif) | Koscto,A. - Kostelny..> | 2015-03-18 18:45 | 1.2M | |
![[ ]](/icons/layout.gif) | Kosten,M. - Kott,M.pdf | 2015-03-18 18:45 | 1.2M | |
![[ ]](/icons/layout.gif) | Kott,S. - Koval,J.pdf | 2015-03-18 18:46 | 1.1M | |
![[ ]](/icons/layout.gif) | Koval,J. - Kowalski,..> | 2015-03-18 18:47 | 1.4M | |
![[ ]](/icons/layout.gif) | Kowalski,K. - Kozlof..> | 2015-03-18 18:48 | 1.1M | |
![[ ]](/icons/layout.gif) | Kozlov,H. - Kraft,In..> | 2015-03-18 18:48 | 1.5M | |
![[ ]](/icons/layout.gif) | Kraft,M. - Kramer,E.pdf | 2015-03-18 18:49 | 1.3M | |
![[ ]](/icons/layout.gif) | Kramer,E. - Kramer,S..> | 2015-03-18 18:50 | 1.1M | |
![[ ]](/icons/layout.gif) | Kramer,S. - Krasnies..> | 2015-03-18 18:51 | 1.5M | |
![[ ]](/icons/layout.gif) | Krasnoff,A. - Kraush..> | 2015-03-18 18:51 | 1.3M | |
![[ ]](/icons/layout.gif) | Krauskopf,B. - Kravi..> | 2015-03-18 18:52 | 1.0M | |
![[ ]](/icons/layout.gif) | Krawchenko,F. - Krek..> | 2015-03-18 18:53 | 1.1M | |
![[ ]](/icons/layout.gif) | Kreckorian,S. - Kres..> | 2015-03-18 18:55 | 1.2M | |
![[ ]](/icons/layout.gif) | Kress,H. - Krieger,H..> | 2015-03-18 18:55 | 1.4M | |
![[ ]](/icons/layout.gif) | Krieger,J. - Krizano..> | 2015-03-18 18:56 | 1.3M | |
![[ ]](/icons/layout.gif) | Krizanovic,J. - Kron..> | 2015-03-18 18:57 | 1.5M | |
![[ ]](/icons/layout.gif) | Kronenberg,S. - Krue..> | 2015-03-18 18:58 | 1.1M | |
![[ ]](/icons/layout.gif) | Krueger,Gottfried Br..> | 2015-03-18 18:59 | 1.3M | |
![[ ]](/icons/layout.gif) | Krull,H. - Kruse Tru..> | 2015-03-18 18:59 | 1.4M | |
![[ ]](/icons/layout.gif) | Kruse Trucking Compa..> | 2015-03-18 19:00 | 1.7M | |
![[ ]](/icons/layout.gif) | Kubas,E. - Kuczynski..> | 2015-03-18 19:01 | 1.4M | |
![[ ]](/icons/layout.gif) | Kuczynski,F. - Kugle..> | 2015-03-18 19:02 | 1.3M | |
![[ ]](/icons/layout.gif) | Kugler,G.,Jr. - Kuhn..> | 2015-03-18 19:02 | 1.1M | |
![[ ]](/icons/layout.gif) | Kuhn,L. - Kulite Sem..> | 2015-03-18 19:03 | 1.1M | |
![[ ]](/icons/layout.gif) | Kuliver,J. - Kunick,..> | 2015-03-18 19:04 | 1.4M | |
![[ ]](/icons/layout.gif) | Kunin,E. - Kupfer,H.pdf | 2015-03-18 19:05 | 1.3M | |
![[ ]](/icons/layout.gif) | Kupfre,H. - Kurlan,M..> | 2015-03-18 19:06 | 1.5M | |
![[ ]](/icons/layout.gif) | Kurland,A. - Kuritz,..> | 2015-03-18 19:06 | 1.4M | |
![[ ]](/icons/layout.gif) | Kurtz,L. - Kush,H.pdf | 2015-03-18 19:07 | 1.8M | |
![[ ]](/icons/layout.gif) | Kush,J. - Kutyla,A.pdf | 2015-03-18 19:08 | 1.2M | |
![[ ]](/icons/layout.gif) | Kutyla,J. - Kynor,C...> | 2015-03-18 19:09 | 1.6M | |
![[ ]](/icons/layout.gif) | Kynor,G. - L.T.Co. #..> | 2015-03-18 19:10 | 1.4M | |
![[ ]](/icons/layout.gif) | L.T. Line #4 - Labor..> | 2015-03-18 19:10 | 1.1M | |
![[ ]](/icons/layout.gif) | LaBranche,J. - Lachi..> | 2015-03-18 19:12 | 1.1M | |
![[ ]](/icons/layout.gif) | LaCorte,J. - Laduca,..> | 2015-03-18 19:13 | 1.5M | |
![[ ]](/icons/layout.gif) | LaDuca,A. - Laferty,..> | 2015-03-18 19:14 | 1.3M | |
![[ ]](/icons/layout.gif) | LaMarra,R. - Lambert..> | 2015-03-18 19:20 | 1.2M | |
![[ ]](/icons/layout.gif) | LaPella,A. - Lapp,M.pdf | 2015-03-18 19:36 | 1.0M | |
![[ ]](/icons/layout.gif) | LaRosa,A. - Larsen,J..> | 2015-03-18 19:39 | 1.2M | |
![[ ]](/icons/layout.gif) | LaSalle Co. - Laskow..> | 2015-03-18 19:40 | 965K | |
![[ ]](/icons/layout.gif) | Labor, - Labrada,G.pdf | 2015-03-18 19:11 | 830K | |
![[ ]](/icons/layout.gif) | Lachiewicz,S. - LaCo..> | 2015-03-18 19:13 | 1.5M | |
![[ ]](/icons/layout.gif) | Lafferty,J. - Lagoa,..> | 2015-03-18 19:15 | 1.3M | |
![[ ]](/icons/layout.gif) | Lagoe,N. - Laird,A.pdf | 2015-03-18 19:16 | 1.1M | |
![[ ]](/icons/layout.gif) | Laird Associates,Inc..> | 2015-03-18 19:16 | 775K | |
![[ ]](/icons/layout.gif) | Lake Asbestos of Que..> | 2015-03-18 19:17 | 1.1M | |
![[ ]](/icons/layout.gif) | Lakes,R. - Lally,W.pdf | 2015-03-18 19:18 | 1.1M | |
![[ ]](/icons/layout.gif) | Lalley,A. - LaMarra,..> | 2015-03-18 19:19 | 1.1M | |
![[ ]](/icons/layout.gif) | Lambert,H. - Lambrec..> | 2015-03-18 19:20 | 1.8M | |
![[ ]](/icons/layout.gif) | Lambros,G.,Jr. - Lam..> | 2015-03-18 19:21 | 1.3M | |
![[ ]](/icons/layout.gif) | Lampart,M. - Lance M..> | 2015-03-18 19:22 | 1.8M | |
![[ ]](/icons/layout.gif) | Lance,T. - Lands.pdf | 2015-03-18 19:23 | 1.6M | |
![[ ]](/icons/layout.gif) | Land - Land.pdf | 2015-03-18 19:27 | 5.5M | |
![[ ]](/icons/layout.gif) | Land - Lande,S.pdf | 2015-03-18 19:29 | 2.8M | |
![[ ]](/icons/layout.gif) | Lande,S. - Landolfi,..> | 2015-03-18 19:30 | 1.1M | |
![[ ]](/icons/layout.gif) | Landolfi,M. - Lane,E..> | 2015-03-18 19:31 | 1.5M | |
![[ ]](/icons/layout.gif) | Lane,E. - Lang,A.pdf | 2015-03-18 19:31 | 1.3M | |
![[ ]](/icons/layout.gif) | Lang,A. - Langdon,J...> | 2015-03-18 19:32 | 1.7M | |
![[ ]](/icons/layout.gif) | Langdon,J.,Jr. - Lan..> | 2015-03-18 19:33 | 1.2M | |
![[ ]](/icons/layout.gif) | Langer Leasing Inc. ..> | 2015-03-18 19:34 | 1.5M | |
![[ ]](/icons/layout.gif) | Lanier,G. - Lanter,S..> | 2015-03-18 19:35 | 1.7M | |
![[ ]](/icons/layout.gif) | Lanteri,G. - Lapedes..> | 2015-03-18 19:35 | 1.2M | |
![[ ]](/icons/layout.gif) | Lappa,F. - Larimar.pdf | 2015-03-18 19:37 | 1.2M | |
![[ ]](/icons/layout.gif) | Larimore,R. - Laros,..> | 2015-03-18 19:38 | 1.3M | |
![[ ]](/icons/layout.gif) | Larsen,J. - Automobi..> | 2015-03-18 19:39 | 1.1M | |
![[ ]](/icons/layout.gif) | Lasky,A. - Latawiec,..> | 2015-03-18 19:41 | 957K | |
![[ ]](/icons/layout.gif) | Lateef,A. - Lattanzi..> | 2015-03-18 19:41 | 1.0M | |
![[ ]](/icons/layout.gif) | Lattanzi,L. - Estee ..> | 2015-03-18 19:42 | 942K | |
![[ ]](/icons/layout.gif) | Lauder,P. - Laurel P..> | 2015-03-18 19:43 | 696K | |
![[ ]](/icons/layout.gif) | Laurel Race Course,I..> | 2015-03-18 19:44 | 739K | |
![[ ]](/icons/layout.gif) | Laux,R. - Lavery,W.pdf | 2015-03-18 19:44 | 722K | |
![[ ]](/icons/layout.gif) | Laveson,A. - Law,C.pdf | 2015-03-18 19:45 | 752K | |
![[ ]](/icons/layout.gif) | Law,D. - Lawrence Be..> | 2015-03-18 19:46 | 709K | |
![[ ]](/icons/layout.gif) | Lawrence,B. - Lawren..> | 2015-03-18 19:46 | 837K | |
![[ ]](/icons/layout.gif) | Lawrence,M. - Lawson..> | 2015-03-18 19:47 | 749K | |
![[ ]](/icons/layout.gif) | Lawson,O. - Layton,G..> | 2015-03-18 19:48 | 748K | |
![[ ]](/icons/layout.gif) | Layton,G. - Lazere F..> | 2015-03-18 19:48 | 715K | |
![[ ]](/icons/layout.gif) | Lazerow,E. - Leach,J..> | 2015-03-18 19:49 | 728K | |
![[ ]](/icons/layout.gif) | Leach,J. - Leap,C.pdf | 2015-03-18 19:50 | 681K | |
![[ ]](/icons/layout.gif) | Leap,E. - Leatherby,..> | 2015-03-18 19:50 | 676K | |
![[ ]](/icons/layout.gif) | Leatherman,B. - LeBl..> | 2015-03-18 19:51 | 673K | |
![[ ]](/icons/layout.gif) | Lebo Press Co. - Led..> | 2015-03-18 19:52 | 716K | |
![[ ]](/icons/layout.gif) | Ledden,E. - Lee,B.pdf | 2015-03-18 19:52 | 697K | |
![[ ]](/icons/layout.gif) | Lee,B. - Lee,J.pdf | 2015-03-18 19:53 | 677K | |
![[ ]](/icons/layout.gif) | Lee,J. - Lee Myles A..> | 2015-03-18 19:54 | 706K | |
![[ ]](/icons/layout.gif) | Lee,N. - Lee,T.pdf | 2015-03-18 19:55 | 714K | |
![[ ]](/icons/layout.gif) | Lee Transt Corp. - L..> | 2015-03-18 19:53 | 749K | |
![[ ]](/icons/layout.gif) | Leeds Music Corp. - ..> | 2015-03-18 19:55 | 720K | |
![[ ]](/icons/layout.gif) | Lefelt,S. - Legdon,M..> | 2015-03-18 19:56 | 809K | |
![[ ]](/icons/layout.gif) | Legenzi,C. - Lehigh ..> | 2015-03-18 19:57 | 824K | |
![[ ]](/icons/layout.gif) | Lehigh Trans.Co - Le..> | 2015-03-18 19:58 | 1.2M | |
![[ ]](/icons/layout.gif) | Lehigh Valley R.R. C..> | 2015-03-18 20:00 | 2.3M | |
![[ ]](/icons/layout.gif) | Lehigh Valley R.R. C..> | 2015-03-18 20:01 | 1.0M | |
![[ ]](/icons/layout.gif) | Lehman,H. - Lehrhoff..> | 2015-03-18 20:02 | 901K | |
![[ ]](/icons/layout.gif) | Lehrhoff,A. - Leidy,..> | 2015-03-18 20:02 | 925K | |
![[ ]](/icons/layout.gif) | Leieinweber,J. - Lei..> | 2015-03-18 20:03 | 833K | |
![[ ]](/icons/layout.gif) | Leiter,M. - Lemansky..> | 2015-03-18 20:04 | 1.1M | |
![[ ]](/icons/layout.gif) | Lemansky & Co.D. - L..> | 2015-03-18 20:04 | 867K | |
![[ ]](/icons/layout.gif) | Lemmon,J.P. - Lencon..> | 2015-03-18 20:05 | 784K | |
![[ ]](/icons/layout.gif) | Lenda,M. - Lenox,J.pdf | 2015-03-18 20:06 | 831K | |
![[ ]](/icons/layout.gif) | Lenox Laboratories,I..> | 2015-03-18 20:07 | 849K | |
![[ ]](/icons/layout.gif) | Leo,J. - Leonard Iro..> | 2015-03-18 20:07 | 885K | |
![[ ]](/icons/layout.gif) | Leonard,I. - Leonars..> | 2015-03-18 20:08 | 880K | |
![[ ]](/icons/layout.gif) | Leonawicz,M. - Leper..> | 2015-03-18 20:09 | 756K | |
![[ ]](/icons/layout.gif) | Lepera,P. - Lerf,C.pdf | 2015-03-18 20:09 | 784K | |
![[ ]](/icons/layout.gif) | Lerf,W. - Leroy D.pdf | 2015-03-18 20:10 | 694K | |
![[ ]](/icons/layout.gif) | Leroy D. - Leslie Ho..> | 2015-03-18 20:11 | 694K | |
![[ ]](/icons/layout.gif) | Leslie - Hughes,D. -..> | 2015-03-18 20:11 | 680K | |
![[ ]](/icons/layout.gif) | Lester,E. - Letts,J.pdf | 2015-03-18 20:12 | 654K | |
![[ ]](/icons/layout.gif) | Letts,J. - Levenstei..> | 2015-03-18 20:12 | 711K | |
![[ ]](/icons/layout.gif) | Levenstein,D. - Levi..> | 2015-03-18 20:13 | 716K | |
![[ ]](/icons/layout.gif) | Levin,A. - Levin,M.pdf | 2015-03-18 20:14 | 720K | |
![[ ]](/icons/layout.gif) | Levin,M. - Levine,E.pdf | 2015-03-18 20:14 | 716K | |
![[ ]](/icons/layout.gif) | Levine,E. - levine,M..> | 2015-03-18 20:15 | 719K | |
![[ ]](/icons/layout.gif) | Levine,M. - Levinson..> | 2015-03-18 20:16 | 752K | |
![[ ]](/icons/layout.gif) | Levinson,S. - Levy,C..> | 2015-03-18 20:16 | 690K | |
![[ ]](/icons/layout.gif) | Levy,C. - Levy,L.pdf | 2015-03-18 20:17 | 750K | |
![[ ]](/icons/layout.gif) | Levy,L. - Lewan,R.pdf | 2015-03-18 20:18 | 803K | |
![[ ]](/icons/layout.gif) | Lewan,T. - Lewis,B.pdf | 2015-03-18 20:18 | 779K | |
![[ ]](/icons/layout.gif) | Lewis,B. - Lewis,F.pdf | 2015-03-18 20:20 | 680K | |
![[ ]](/icons/layout.gif) | Lewis,J. - Lewis,P.pdf | 2015-03-18 20:20 | 679K | |
![[ ]](/icons/layout.gif) | Lewis,P. - Lewis,W.pdf | 2015-03-18 20:21 | 703K | |
![[ ]](/icons/layout.gif) | Lewis,W. - LI, C.pdf | 2015-03-18 20:22 | 702K | |
![[ ]](/icons/layout.gif) | Lewis Flying Service..> | 2015-03-18 20:19 | 758K | |
![[ ]](/icons/layout.gif) | Li,H. - Liberty Lamp..> | 2015-03-18 20:23 | 781K | |
![[ ]](/icons/layout.gif) | Li Calsi, G. - Licht..> | 2015-03-18 20:22 | 780K | |
![[ ]](/icons/layout.gif) | Liberty Lane Block C..> | 2015-03-18 20:24 | 728K | |
![[ ]](/icons/layout.gif) | Lichtman,H. - Lieber..> | 2015-03-18 20:25 | 789K | |
![[ ]](/icons/layout.gif) | Lieberman,H. - Liebs..> | 2015-03-18 20:25 | 712K | |
![[ ]](/icons/layout.gif) | Liedtka,F. - Lighter..> | 2015-03-18 20:26 | 712K | |
![[ ]](/icons/layout.gif) | Lighter Captains Uni..> | 2015-03-18 20:26 | 634K | |
![[ ]](/icons/layout.gif) | Lilie,E. - Lim,L.pdf | 2015-03-18 20:27 | 748K | |
![[ ]](/icons/layout.gif) | Lim,L. - Lincoln Fas..> | 2015-03-18 20:28 | 771K | |
![[ ]](/icons/layout.gif) | Lincoln Federal Savi..> | 2015-03-18 20:29 | 717K | |
![[ ]](/icons/layout.gif) | Lindabury,E. - Linde..> | 2015-03-18 20:29 | 764K | |
![[ ]](/icons/layout.gif) | Lindr,C. - Lindsley,..> | 2015-03-18 20:30 | 683K | |
![[ ]](/icons/layout.gif) | Lindsley,F. - Link,D..> | 2015-03-18 20:31 | 720K | |
![[ ]](/icons/layout.gif) | Link,E. - Linta.pdf | 2015-03-18 20:31 | 694K | |
![[ ]](/icons/layout.gif) | Linta - Lipitz,J.pdf | 2015-03-18 20:32 | 714K | |
![[ ]](/icons/layout.gif) | Lipka,T. - Lippincot..> | 2015-03-18 20:33 | 734K | |
![[ ]](/icons/layout.gif) | Lippincott,R. - Lips..> | 2015-03-18 20:33 | 733K | |
![[ ]](/icons/layout.gif) | Lipsy,F. - Liquor.pdf | 2015-03-18 20:34 | 883K | |
![[ ]](/icons/layout.gif) | Liquor - Liseno,C.pdf | 2015-03-18 20:35 | 801K | |
![[ ]](/icons/layout.gif) | Lisesko,A. - Lit Dru..> | 2015-03-18 20:35 | 731K | |
![[ ]](/icons/layout.gif) | Lit Drug Co. - Littl..> | 2015-03-18 20:36 | 823K | |
![[ ]](/icons/layout.gif) | Little,F. - Littman,..> | 2015-03-18 20:37 | 723K | |
![[ ]](/icons/layout.gif) | Littman,N. - Litzeba..> | 2015-03-18 20:37 | 650K | |
![[ ]](/icons/layout.gif) | Litzner,S. - Livings..> | 2015-03-18 20:38 | 769K | |
![[ ]](/icons/layout.gif) | Livingston,J. - Lloy..> | 2015-03-18 20:39 | 714K | |
![[ ]](/icons/layout.gif) | Lloyd's Insurance Co..> | 2015-03-18 20:40 | 711K | |
![[ ]](/icons/layout.gif) | Lloyd,I. - Lloyd's I..> | 2015-03-18 20:40 | 825K | |
![[ ]](/icons/layout.gif) | Lo Bue,A. - Local #8..> | 2015-03-18 20:41 | 834K | |
![[ ]](/icons/layout.gif) | Local #80 - A - Loca..> | 2015-03-18 20:44 | 862K | |
![[ ]](/icons/layout.gif) | Local #199_847 - Loc..> | 2015-03-18 20:43 | 840K | |
![[ ]](/icons/layout.gif) | Local #427 - Teamste..> | 2015-03-18 20:43 | 909K | |
![[ ]](/icons/layout.gif) | Local #1833 - Lock-H..> | 2015-03-18 20:42 | 754K | |
![[ ]](/icons/layout.gif) | Local Union #560 - L..> | 2015-03-18 20:45 | 894K | |
![[ ]](/icons/layout.gif) | Lock Stock'N Barrell..> | 2015-03-18 20:46 | 739K | |
![[ ]](/icons/layout.gif) | Locust Grove Co. - L..> | 2015-03-18 20:46 | 783K | |
![[ ]](/icons/layout.gif) | Loev Co. - Lofting,C..> | 2015-03-18 20:47 | 713K | |
![[ ]](/icons/layout.gif) | Loftis,D.G. - Loggia..> | 2015-03-18 20:48 | 770K | |
![[ ]](/icons/layout.gif) | Loh,G. - Lo Macchio,..> | 2015-03-18 20:48 | 779K | |
![[ ]](/icons/layout.gif) | Lomachinsky,M. - Lom..> | 2015-03-18 20:49 | 762K | |
![[ ]](/icons/layout.gif) | Lombardino,A. - Lanc..> | 2015-03-18 20:50 | 726K | |
![[ ]](/icons/layout.gif) | Lonczynski,M. - Long..> | 2015-03-18 20:51 | 778K | |
![[ ]](/icons/layout.gif) | Long Beach - Long Is..> | 2015-03-18 20:51 | 800K | |
![[ ]](/icons/layout.gif) | Long Island - Longen..> | 2015-03-18 20:52 | 751K | |
![[ ]](/icons/layout.gif) | Longenhagen,F. - Lon..> | 2015-03-18 20:53 | 812K | |
![[ ]](/icons/layout.gif) | Lonsdale,O. - Lopez,..> | 2015-03-18 20:54 | 825K | |
![[ ]](/icons/layout.gif) | Lopez,A. - Lopresti,..> | 2015-03-18 20:54 | 650K | |
![[ ]](/icons/layout.gif) | Lopresti,P. - Lordi,..> | 2015-03-18 20:55 | 820K | |
![[ ]](/icons/layout.gif) | Lordi,J. - Lorillard..> | 2015-03-18 20:56 | 756K | |
![[ ]](/icons/layout.gif) | Lorillard,P. - Losso..> | 2015-03-18 20:56 | 782K | |
![[ ]](/icons/layout.gif) | Losso,R. - Loughlin,..> | 2015-03-18 20:57 | 757K | |
![[ ]](/icons/layout.gif) | Loughlin,L. - Lourie..> | 2015-03-18 20:58 | 781K | |
![[ ]](/icons/layout.gif) | Lourie,L. - Loveladi..> | 2015-03-18 20:58 | 715K | |
![[ ]](/icons/layout.gif) | Loveland,C. - Low Bi..> | 2015-03-18 20:59 | 737K | |
![[ ]](/icons/layout.gif) | Low,C. - Lowe,S.pdf | 2015-03-18 21:00 | 753K | |
![[ ]](/icons/layout.gif) | Lowe,S. - Lowery,R.pdf | 2015-03-18 21:01 | 783K | |
![[ ]](/icons/layout.gif) | Lowery,R. - L-Trypto..> | 2015-03-18 21:01 | 750K | |
![[ ]](/icons/layout.gif) | Luca,D. - Lucas,M.pdf | 2015-03-18 21:02 | 660K | |
![[ ]](/icons/layout.gif) | Lucas,M. - Luciani C..> | 2015-03-18 21:02 | 683K | |
![[ ]](/icons/layout.gif) | Luciani,J. - Luckenb..> | 2015-03-18 21:03 | 732K | |
![[ ]](/icons/layout.gif) | Luckenbach Terminals..> | 2015-03-18 21:04 | 737K | |
![[ ]](/icons/layout.gif) | Ludlow,T. - Luggo, O..> | 2015-03-18 21:05 | 736K | |
![[ ]](/icons/layout.gif) | Luggosy,G. - Luke,G.pdf | 2015-03-18 21:05 | 663K | |
![[ ]](/icons/layout.gif) | Luke,G. - Lumberton ..> | 2015-03-18 21:06 | 729K | |
![[ ]](/icons/layout.gif) | Luma1,Inc. - Luca,B...> | 2015-03-18 21:06 | 719K | |
![[ ]](/icons/layout.gif) | Lumere,R. - Lung,L.pdf | 2015-03-18 21:07 | 653K | |
![[ ]](/icons/layout.gif) | Lung,M. - Lupoli,M.pdf | 2015-03-18 21:08 | 669K | |
![[ ]](/icons/layout.gif) | Lupoli,S. - Lustbade..> | 2015-03-18 21:08 | 709K | |
![[ ]](/icons/layout.gif) | Lustbader,I. - Lutti..> | 2015-03-18 21:09 | 789K | |
![[ ]](/icons/layout.gif) | Luttman,K. - Luzitan..> | 2015-03-18 21:10 | 743K | |
![[ ]](/icons/layout.gif) | Luzzatti,E. - Lyncar..> | 2015-03-18 21:11 | 702K | |
![[ ]](/icons/layout.gif) | Lynch (alias) - Lync..> | 2015-03-18 21:11 | 837K | |
![[ ]](/icons/layout.gif) | Lynch,J. - Lynd,A.pdf | 2015-03-18 21:12 | 717K | |
![[ ]](/icons/layout.gif) | Lynd,D. - Lyons,B.pdf | 2015-03-18 21:13 | 703K | |
![[ ]](/icons/layout.gif) | Lyons & Shafto Inc. ..> | 2015-03-18 21:13 | 803K | |
![[ ]](/icons/layout.gif) | Lyons,C. - Lyons & S..> | 2015-03-18 21:14 | 683K | |
![[ ]](/icons/layout.gif) | MCA, Inc. - M.M.pdf | 2015-03-18 22:24 | 661K | |
![[ ]](/icons/layout.gif) | M_M MilesLerman - M_..> | 2015-03-18 21:15 | 747K | |
![[ ]](/icons/layout.gif) | M_V Finnbuilder - Ma..> | 2015-03-18 21:15 | 711K | |
![[ ]](/icons/layout.gif) | MacAndrew & Forbes C..> | 2015-03-18 21:17 | 957K | |
![[ ]](/icons/layout.gif) | MacDougall,J. - Mach..> | 2015-03-18 21:18 | 689K | |
![[ ]](/icons/layout.gif) | MacKenzie,K. - Macki..> | 2015-03-18 21:21 | 747K | |
![[ ]](/icons/layout.gif) | Mac Millan,D. - Macr..> | 2015-03-18 21:16 | 785K | |
![[ ]](/icons/layout.gif) | Macchia,J. - MacDoug..> | 2015-03-18 21:18 | 708K | |
![[ ]](/icons/layout.gif) | Machado,J. - Automob..> | 2015-03-18 21:19 | 776K | |
![[ ]](/icons/layout.gif) | Mack Machine Co.,Inc..> | 2015-03-18 21:20 | 712K | |
![[ ]](/icons/layout.gif) | Mackinnon,M. - Macmi..> | 2015-03-18 21:21 | 779K | |
![[ ]](/icons/layout.gif) | Macri,S. - Maddaluno..> | 2015-03-18 21:22 | 772K | |
![[ ]](/icons/layout.gif) | Maddatu,N. - Madewel..> | 2015-03-18 21:23 | 750K | |
![[ ]](/icons/layout.gif) | Madge - Madsen Realt..> | 2015-03-18 21:23 | 792K | |
![[ ]](/icons/layout.gif) | Madson,J. - Magee,H.pdf | 2015-03-18 21:24 | 807K | |
![[ ]](/icons/layout.gif) | Magee,H. - Maggioi,J..> | 2015-03-18 21:25 | 734K | |
![[ ]](/icons/layout.gif) | Maggs & Vidal,P.A. -..> | 2015-03-18 21:25 | 735K | |
![[ ]](/icons/layout.gif) | Magner,J. - Maguire,..> | 2015-03-18 21:26 | 709K | |
![[ ]](/icons/layout.gif) | Maguire,M. - Maher,M..> | 2015-03-18 21:27 | 759K | |
![[ ]](/icons/layout.gif) | Maher,M. - Mahon,R.pdf | 2015-03-18 21:28 | 763K | |
![[ ]](/icons/layout.gif) | Mahon,S. - Maiden,B.pdf | 2015-03-18 21:28 | 803K | |
![[ ]](/icons/layout.gif) | Maiden,Jr.,C. - Main..> | 2015-03-18 21:29 | 779K | |
![[ ]](/icons/layout.gif) | Main,R. - Maio,L.pdf | 2015-03-18 21:30 | 766K | |
![[ ]](/icons/layout.gif) | Maio,L. - Maisto,H.pdf | 2015-03-18 21:30 | 787K | |
![[ ]](/icons/layout.gif) | Maisto,H. - Major,M.pdf | 2015-03-18 21:31 | 696K | |
![[ ]](/icons/layout.gif) | Major Muffler Center..> | 2015-03-18 21:32 | 709K | |
![[ ]](/icons/layout.gif) | Makowski,R. - Malano..> | 2015-03-18 21:32 | 837K | |
![[ ]](/icons/layout.gif) | Malanowski,B. - Male..> | 2015-03-18 21:33 | 753K | |
![[ ]](/icons/layout.gif) | Malenchak,J. - Malin..> | 2015-03-18 21:34 | 775K | |
![[ ]](/icons/layout.gif) | Malinowich,J. - Mall..> | 2015-03-18 21:34 | 708K | |
![[ ]](/icons/layout.gif) | Malley Trucking Corp..> | 2015-03-18 21:35 | 724K | |
![[ ]](/icons/layout.gif) | Malmut,B. - Maloney,..> | 2015-03-18 21:36 | 832K | |
![[ ]](/icons/layout.gif) | Maloney,P. - Maluski..> | 2015-03-18 21:37 | 810K | |
![[ ]](/icons/layout.gif) | Maluski,M. - Manarac..> | 2015-03-18 21:37 | 841K | |
![[ ]](/icons/layout.gif) | Manarevic,G. - Manco..> | 2015-03-18 21:38 | 758K | |
![[ ]](/icons/layout.gif) | Manco Steel Prod.,In..> | 2015-03-18 21:39 | 777K | |
![[ ]](/icons/layout.gif) | Mandelbaum,P. - Mane..> | 2015-03-18 21:40 | 771K | |
![[ ]](/icons/layout.gif) | Maney,J. - Manger,JJ..> | 2015-03-18 21:40 | 800K | |
![[ ]](/icons/layout.gif) | Manger,L. - Manhatta..> | 2015-03-18 21:41 | 815K | |
![[ ]](/icons/layout.gif) | Manhattan Life Ins. ..> | 2015-03-18 21:42 | 773K | |
![[ ]](/icons/layout.gif) | Manley,J. - Mannarin..> | 2015-03-18 21:43 | 785K | |
![[ ]](/icons/layout.gif) | Mannarino,P. - Manni..> | 2015-03-18 21:43 | 735K | |
![[ ]](/icons/layout.gif) | Mannington Mills,Inc..> | 2015-03-18 21:44 | 898K | |
![[ ]](/icons/layout.gif) | Mansfield,J. - Mantu..> | 2015-03-18 21:45 | 772K | |
![[ ]](/icons/layout.gif) | Mantua Pharmacy - Ma..> | 2015-03-18 21:45 | 840K | |
![[ ]](/icons/layout.gif) | Manuwald,A. - Manzol..> | 2015-03-18 21:46 | 742K | |
![[ ]](/icons/layout.gif) | Manzolillo,J. - Mara..> | 2015-03-18 21:47 | 724K | |
![[ ]](/icons/layout.gif) | Marboro Books - Marc..> | 2015-03-18 21:47 | 713K | |
![[ ]](/icons/layout.gif) | Marchegiano,M. - Mar..> | 2015-03-18 21:48 | 722K | |
![[ ]](/icons/layout.gif) | Marchulonis,A. - Mar..> | 2015-03-18 21:49 | 759K | |
![[ ]](/icons/layout.gif) | Marcoux,P. - Marcus,..> | 2015-03-18 21:50 | 725K | |
![[ ]](/icons/layout.gif) | Marcus,S. - Mareniss..> | 2015-03-18 21:50 | 722K | |
![[ ]](/icons/layout.gif) | Mareno,J. - Margo,J.pdf | 2015-03-18 21:51 | 710K | |
![[ ]](/icons/layout.gif) | Margo,W. - Mari,A.pdf | 2015-03-18 21:51 | 725K | |
![[ ]](/icons/layout.gif) | Marguard,R.,Jr. - Ma..> | 2015-03-18 21:52 | 683K | |
![[ ]](/icons/layout.gif) | Mari,C. - Marilla,F.pdf | 2015-03-18 21:53 | 687K | |
![[ ]](/icons/layout.gif) | Mariano,L. - Maritim..> | 2015-03-18 21:53 | 679K | |
![[ ]](/icons/layout.gif) | Marillo,C. - Marine ..> | 2015-03-18 21:54 | 640K | |
![[ ]](/icons/layout.gif) | Marine,M. - Marini,A..> | 2015-03-18 21:55 | 694K | |
![[ ]](/icons/layout.gif) | Marini,E. - Marino,L..> | 2015-03-18 21:55 | 680K | |
![[ ]](/icons/layout.gif) | Maritime Hamony - Ma..> | 2015-03-18 21:56 | 719K | |
![[ ]](/icons/layout.gif) | Markert,J. - Markoe,..> | 2015-03-18 21:57 | 791K | |
![[ ]](/icons/layout.gif) | Markogianis,M. - Mar..> | 2015-03-18 21:57 | 697K | |
![[ ]](/icons/layout.gif) | Marks,G. - Police De..> | 2015-03-18 21:58 | 712K | |
![[ ]](/icons/layout.gif) | Marlboro Psychiatric..> | 2015-03-18 21:59 | 701K | |
![[ ]](/icons/layout.gif) | Marnin,J. - Marguard..> | 2015-03-18 21:59 | 734K | |
![[ ]](/icons/layout.gif) | Marriot,G. - Marsden..> | 2015-03-18 22:00 | 702K | |
![[ ]](/icons/layout.gif) | Marseglia,D. - Marsh..> | 2015-03-18 22:01 | 681K | |
![[ ]](/icons/layout.gif) | Marshall,F. - Marsha..> | 2015-03-18 22:01 | 686K | |
![[ ]](/icons/layout.gif) | Marshall,R. - Martan..> | 2015-03-18 22:02 | 678K | |
![[ ]](/icons/layout.gif) | Martanz,H. - Martin,..> | 2015-03-18 22:03 | 709K | |
![[ ]](/icons/layout.gif) | Martin,A. - Martin,E..> | 2015-03-18 22:03 | 694K | |
![[ ]](/icons/layout.gif) | Martin,E. - Martin,I..> | 2015-03-18 22:04 | 763K | |
![[ ]](/icons/layout.gif) | Martin,J. - Martin,J..> | 2015-03-18 22:05 | 815K | |
![[ ]](/icons/layout.gif) | Martin,J. - Martin,P..> | 2015-03-18 22:05 | 732K | |
![[ ]](/icons/layout.gif) | Martin,P. - Martin,W..> | 2015-03-18 22:06 | 690K | |
![[ ]](/icons/layout.gif) | Martin,W. - Martinez..> | 2015-03-18 22:07 | 683K | |
![[ ]](/icons/layout.gif) | Martinez,H. - Martin..> | 2015-03-18 22:07 | 639K | |
![[ ]](/icons/layout.gif) | Martinique,P. - Mart..> | 2015-03-18 22:08 | 712K | |
![[ ]](/icons/layout.gif) | Martone,P. - Maruffi..> | 2015-03-18 22:09 | 745K | |
![[ ]](/icons/layout.gif) | Maruffi,B. - Mary Mo..> | 2015-03-18 22:09 | 853K | |
![[ ]](/icons/layout.gif) | Mary,Power Boat - Ma..> | 2015-03-18 22:10 | 918K | |
![[ ]](/icons/layout.gif) | Maryland Casualty Co..> | 2015-03-18 22:11 | 797K | |
![[ ]](/icons/layout.gif) | Marzullo,A. - Masi,C..> | 2015-03-18 22:11 | 764K | |
![[ ]](/icons/layout.gif) | Masi,F. - Mason & Di..> | 2015-03-18 22:12 | 804K | |
![[ ]](/icons/layout.gif) | Mason & Dixon Lines,..> | 2015-03-18 22:13 | 771K | |
![[ ]](/icons/layout.gif) | Mason,R. - Mass.Mutu..> | 2015-03-18 22:13 | 845K | |
![[ ]](/icons/layout.gif) | Mass. Mutual Life In..> | 2015-03-18 22:14 | 796K | |
![[ ]](/icons/layout.gif) | Massi,D. - Masters,M..> | 2015-03-18 22:15 | 778K | |
![[ ]](/icons/layout.gif) | Masters,Mates & Pilo..> | 2015-03-18 22:15 | 714K | |
![[ ]](/icons/layout.gif) | Mastrogiovanni,J. - ..> | 2015-03-18 22:16 | 882K | |
![[ ]](/icons/layout.gif) | Mate,W. - Matheson G..> | 2015-03-18 22:17 | 796K | |
![[ ]](/icons/layout.gif) | Matheson,G. - Mathis..> | 2015-03-18 22:17 | 858K | |
![[ ]](/icons/layout.gif) | Mathis,D. - Matlack,..> | 2015-03-18 22:18 | 695K | |
![[ ]](/icons/layout.gif) | Matlack,R. - Matteo ..> | 2015-03-18 22:18 | 715K | |
![[ ]](/icons/layout.gif) | Matteo Builders,Inc...> | 2015-03-18 22:19 | 733K | |
![[ ]](/icons/layout.gif) | Matthews,F. - Matthi..> | 2015-03-18 22:20 | 733K | |
![[ ]](/icons/layout.gif) | Mattia,A. - Mattura,..> | 2015-03-18 22:20 | 788K | |
![[ ]](/icons/layout.gif) | Matturi,A. - Mau,Lam..> | 2015-03-18 22:21 | 797K | |
![[ ]](/icons/layout.gif) | Mau,T. - Maurer,P.pdf | 2015-03-18 22:22 | 824K | |
![[ ]](/icons/layout.gif) | Maurer,P. - Mautner,..> | 2015-03-18 22:22 | 757K | |
![[ ]](/icons/layout.gif) | Mauzy & Morrow & Ass..> | 2015-03-18 22:23 | 766K | |
![[ ]](/icons/layout.gif) | May,J. - Mayer,B.pdf | 2015-03-18 22:23 | 687K | |
|