Index of /PartyIndex
![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | (201) 224-5329 - Men..> | 2015-03-17 12:14 | 23M | |
![[ ]](/icons/layout.gif) | 1-83-CV-01194 - 3-89..> | 2015-03-17 12:29 | 32M | |
![[ ]](/icons/layout.gif) | 2-83-0000175X - 2-90..> | 2015-03-17 12:32 | 8.3M | |
![[ ]](/icons/layout.gif) | 2-88-0000037A - CV-8..> | 2015-03-17 12:46 | 33M | |
![[ ]](/icons/layout.gif) | 2-CV-83-0001635 - 2-..> | 2015-03-17 13:00 | 35M | |
![[ ]](/icons/layout.gif) | 2-CV-85-0003855 - 2-..> | 2015-03-17 13:15 | 35M | |
![[ ]](/icons/layout.gif) | 2-CV-88-0000503 - 2-..> | 2015-03-17 13:30 | 37M | |
![[ ]](/icons/layout.gif) | 2-CV-90-0002428 - 2-..> | 2015-03-17 13:43 | 30M | |
![[ ]](/icons/layout.gif) | 30' Blackwatch Sport..> | 2015-03-17 13:58 | 34M | |
![[ ]](/icons/layout.gif) | 66 Acres of LA - Ame..> | 2015-03-17 14:12 | 28M | |
![[ ]](/icons/layout.gif) | Ames Industries - Ba..> | 2015-03-17 14:39 | 28M | |
![[ ]](/icons/layout.gif) | A to Z Chemical - Mo..> | 2015-03-17 14:26 | 27M | |
![[ ]](/icons/layout.gif) | Barbella, Nicho - Bo..> | 2015-03-17 14:52 | 27M | |
![[ ]](/icons/layout.gif) | Bodman, Roger A - Ca..> | 2015-03-17 15:06 | 27M | |
![[ ]](/icons/layout.gif) | CV190 - CV365.pdf | 2015-03-17 16:13 | 32M | |
![[ ]](/icons/layout.gif) | CV365 - CV550.pdf | 2015-03-17 16:26 | 31M | |
![[ ]](/icons/layout.gif) | CV550 - CV870.pdf | 2015-03-17 16:39 | 31M | |
![[ ]](/icons/layout.gif) | CV870 - CV950.pdf | 2015-03-17 16:42 | 5.7M | |
![[ ]](/icons/layout.gif) | CV Civil - CV190.pdf | 2015-03-17 16:00 | 32M | |
![[ ]](/icons/layout.gif) | Cabral, Frances - Ch..> | 2015-03-17 15:19 | 27M | |
![[ ]](/icons/layout.gif) | Case Activity - 02-2..> | 2015-03-17 15:19 | 463K | |
![[ ]](/icons/layout.gif) | Cheripko, LT - Cooke..> | 2015-03-17 15:33 | 28M | |
![[ ]](/icons/layout.gif) | Cooke, Barry A - Del..> | 2015-03-17 15:46 | 27M | |
![[ ]](/icons/layout.gif) | Delbridge, Adol - Ec..> | 2015-03-17 16:55 | 27M | |
![[ ]](/icons/layout.gif) | Economy Baler C - Fe..> | 2015-03-17 17:07 | 27M | |
![[ ]](/icons/layout.gif) | Ferguson, Rober - GA..> | 2015-03-17 17:20 | 27M | |
![[ ]](/icons/layout.gif) | Fernandez, Jose Urid..> | 2015-03-17 17:21 | 2.9M | |
![[ ]](/icons/layout.gif) | GAF Corp - Grant, Ra..> | 2015-03-17 17:35 | 27M | |
![[ ]](/icons/layout.gif) | Grant, Randy - Hecke..> | 2015-03-17 17:48 | 27M | |
![[ ]](/icons/layout.gif) | Hecker, Stuart - IM ..> | 2015-03-17 18:01 | 27M | |
![[ ]](/icons/layout.gif) | IM, Sung Ju - Jones,..> | 2015-03-17 18:13 | 27M | |
![[ ]](/icons/layout.gif) | Jones, Patricia - Kr..> | 2015-03-17 18:27 | 27M | |
![[ ]](/icons/layout.gif) | Judge Assigne - Seni..> | 2015-03-17 18:31 | 9.1M | |
![[ ]](/icons/layout.gif) | Judge Bissell - Judg..> | 2015-03-17 18:39 | 21M | |
![[ ]](/icons/layout.gif) | Judge Politan - Judg..> | 2015-03-17 18:45 | 13M | |
![[ ]](/icons/layout.gif) | Judge Thomas - Judge..> | 2015-03-17 18:51 | 15M | |
![[ ]](/icons/layout.gif) | Krawczyak, VRSV - Lo..> | 2015-03-17 19:05 | 27M | |
![[ ]](/icons/layout.gif) | Local Union 54 - Mar..> | 2015-03-17 19:18 | 28M | |
![[ ]](/icons/layout.gif) | Magistrate DE - Judg..> | 2015-03-17 19:31 | 14M | |
![[ ]](/icons/layout.gif) | Magistrate De - Judg..> | 2015-03-17 19:25 | 15M | |
![[ ]](/icons/layout.gif) | Marc Rich & CO. - Me..> | 2015-03-17 19:45 | 27M | |
![[ ]](/icons/layout.gif) | Mendez, Jamie - 92 W..> | 2015-03-17 19:53 | 16M | |
![[ ]](/icons/layout.gif) | Mercury Capital - Mu..> | 2015-03-17 20:06 | 27M | |
![[ ]](/icons/layout.gif) | Morejon, Abel - Zulv..> | 2015-03-17 20:15 | 16M | |
![[ ]](/icons/layout.gif) | Morre, Barbara.pdf | 2015-03-17 20:26 | 25M | |
![[ ]](/icons/layout.gif) | Morre, Thomas A - 89..> | 2015-03-17 20:33 | 15M | |
![[ ]](/icons/layout.gif) | Murano, Mariano - No..> | 2015-03-17 20:46 | 28M | |
![[ ]](/icons/layout.gif) | North Bergen, T - Pa..> | 2015-03-17 21:00 | 27M | |
![[ ]](/icons/layout.gif) | Paskow, David - Posi..> | 2015-03-17 21:13 | 27M | |
![[ ]](/icons/layout.gif) | Patricella, MIC - Pa..> | 2015-03-17 21:13 | 61K | |
![[ ]](/icons/layout.gif) | Poskanzer, Davi - Re..> | 2015-03-17 21:26 | 27M | |
![[ ]](/icons/layout.gif) | Renfrew Doroth - S.K..> | 2015-03-17 21:39 | 27M | |
![[ ]](/icons/layout.gif) | S.L. Bldg. Co. - She..> | 2015-03-17 21:51 | 27M | |
![[ ]](/icons/layout.gif) | Shearson Lehman - St..> | 2015-03-17 22:05 | 27M | |
![[ ]](/icons/layout.gif) | St. Clare's HOS - Te..> | 2015-03-17 22:18 | 27M | |
![[ ]](/icons/layout.gif) | Texaco, INC. - VHL, ..> | 2015-03-17 22:32 | 27M | |
![[ ]](/icons/layout.gif) | Total - Total.pdf | 2015-03-17 22:32 | 859K | |
![[ ]](/icons/layout.gif) | Uhlenburg, Gayl - Wa..> | 2015-03-17 22:44 | 27M | |
![[ ]](/icons/layout.gif) | Washburn, Richa - Ya..> | 2015-03-17 22:56 | 26M | |
![[ ]](/icons/layout.gif) | Yarby Assoc. - 995 C..> | 2015-03-17 22:59 | 8.7M | |
|